CAS 2158-04-5
:N-(2-Phenylethyl)urea
Description:
N-(2-Phenylethyl)urea, with the CAS number 2158-04-5, is an organic compound that belongs to the class of ureas. It features a urea functional group (NH2) attached to a phenylethyl moiety, which contributes to its unique properties. This compound is typically characterized by its white crystalline solid form and moderate solubility in polar solvents such as water and alcohols. N-(2-Phenylethyl)urea exhibits interesting biological activities, making it a subject of research in medicinal chemistry. Its structure allows for potential interactions with biological targets, which can lead to various pharmacological effects. Additionally, it may participate in hydrogen bonding due to the presence of the amine groups, influencing its reactivity and interactions in chemical processes. The compound is often synthesized through the reaction of phenylethylamine with isocyanates or other urea derivatives. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c10-9(12)11-7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H3,10,11,12)
InChI key:InChIKey=ZMTSMVZAFDWQRM-UHFFFAOYSA-N
SMILES:C(CNC(N)=O)C1=CC=CC=C1
Synonyms:- (Phenethyl)urea
- 1-Phenethylurea
- 2-Phenylethylurea
- N-(2-phenylethyl)urea
- N-phenethylurea
- NSC 27463
- Phenethylcarbamid
- Urea, (2-phenylethyl)-
- Urea, phenethyl-
- urea, N-(2-phenylethyl)-
- β-Phenylethylurea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.