CAS 2158-14-7: 4-Acetamidobenzenesulfonyl azide
Description:4-Acetamidobenzenesulfonyl azide, with the CAS number 2158-14-7, is an organic compound characterized by its azide functional group and sulfonamide structure. It typically appears as a solid and is known for its reactivity, particularly in click chemistry applications, where it can participate in cycloaddition reactions. The presence of the acetamido group enhances its solubility in polar solvents, making it useful in various synthetic pathways. This compound is often utilized in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals, due to its ability to introduce azide functionalities. Additionally, it is important to handle this compound with care, as azides can be potentially explosive under certain conditions. Its stability can be influenced by factors such as temperature and the presence of other reactive species. Overall, 4-Acetamidobenzenesulfonyl azide serves as a valuable intermediate in organic synthesis, particularly in the development of novel materials and biologically active compounds.
Formula:C8H8N4O3S
InChI:InChI=1S/C8H8N4O3S/c1-6(13)10-7-2-4-8(5-3-7)16(14,15)12-11-9/h2-5H,1H3,(H,10,13)
InChI key:InChIKey=NTMHWRHEGDRTPD-UHFFFAOYSA-N
SMILES:[N-]=[N+]=NS(=O)(=O)C1=CC=C(C=C1)NC(=O)C
- Synonyms:
- 1-{[4-(Acetylamino)Phenyl]Sulfonyl}Triaza-1,2-Dien-2-Ium
- 4-(Acetylamino)Benzenesulfonyl Azide
- 4-Acetamidobenzene-1-sulfonyl azide
- 4-Acetamidophenylsulfonyl azide
- Benzenesulfonyl Azide, 4-(Acetylamino)-
- N-(4-Azidosulfonylphenyl)acetamide
- NSC 82543
- Sulfanilyl azide, N-acetyl-
- p-ABSA
- p-Acetamidobenzenesulfonyl azide
- See more synonyms
- 4-Acetamidobenzenesulfonyl azide
