CymitQuimica logo

CAS 215800-25-2

:

4-Bromo-3-methylbenzeneacetonitrile

Description:
4-Bromo-3-methylbenzeneacetonitrile, also known by its CAS number 215800-25-2, is an organic compound characterized by the presence of a bromine atom, a methyl group, and a nitrile functional group attached to a benzene ring. This compound typically exhibits a molecular structure that includes a bromobenzene moiety, which contributes to its reactivity and potential applications in organic synthesis. The nitrile group (-C≡N) is known for its ability to participate in various chemical reactions, including nucleophilic additions and transformations into other functional groups. The presence of the methyl group can influence the compound's physical properties, such as solubility and boiling point. Generally, compounds like 4-Bromo-3-methylbenzeneacetonitrile are of interest in medicinal chemistry and materials science due to their potential as intermediates in the synthesis of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C9H8BrN
InChI:InChI=1S/C9H8BrN/c1-7-6-8(4-5-11)2-3-9(7)10/h2-3,6H,4H2,1H3
InChI key:InChIKey=OIBRFAUQTMYQLB-UHFFFAOYSA-N
SMILES:C(C#N)C1=CC(C)=C(Br)C=C1
Synonyms:
  • 2-Bromo-5-(cyanomethyl)toluene
  • 2-(4-Bromo-3-methylphenyl)acetonitrile
  • 4-Bromo-3-methylbenzeneacetonitrile
  • (4-Bromo-3-methylphenyl)acetonitrile
  • Benzeneacetonitrile, 4-bromo-3-methyl-
Found 5 products.