CAS 21581-49-7
:6-Nitrodopamine
Description:
6-Nitrodopamine is an organic compound that belongs to the class of catecholamines, which are characterized by the presence of a catechol moiety and an amine group. It is a derivative of dopamine, where a nitro group is substituted at the 6-position of the aromatic ring. This modification can influence its biological activity and reactivity. The compound is typically a yellow to orange solid and is soluble in polar solvents due to the presence of hydroxyl and amine functional groups. 6-Nitrodopamine is of interest in various fields, including medicinal chemistry and neurobiology, as it may exhibit unique pharmacological properties compared to its parent compound, dopamine. Its nitro group can also participate in redox reactions, potentially leading to the formation of reactive intermediates. As with many nitro compounds, it may pose certain safety and handling considerations due to its potential reactivity and toxicity. Overall, 6-Nitrodopamine serves as a valuable compound for research into neurotransmitter function and the development of therapeutic agents.
Formula:C8H10N2O4
InChI:InChI=1S/C8H10N2O4/c9-2-1-5-3-7(11)8(12)4-6(5)10(13)14/h3-4,11-12H,1-2,9H2
InChI key:InChIKey=GAWRYVJRKWPEFX-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(CCN)C=C(O)C(O)=C1
Synonyms:- 1,2-Benzenediol, 4-(2-aminoethyl)-5-nitro-
- 4-(2-Aminoethyl)-5-nitro-1,2-benzenediol
- 6-Nitrodopamine
- Pyrocatechol, 4-(2-aminoethyl)-5-nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(2-Aminoethyl)-5-nitrobenzene-1,2-diol
CAS:Purity:97%Color and Shape:SolidMolecular weight:198.17799381,2-Benzenediol, 4-(2-aminoethyl)-5-nitro-
CAS:Formula:C18H26OPurity:97%Color and Shape:SolidMolecular weight:258.39846-Nitrodopamine
CAS:Controlled ProductApplications 6-Nitrodopamine is a reagent used in the detection of cancer biomarker prostate specific antigen (PSA).
References Li, H., et. al.: Biosensors Bioelectronics, 26, 3044 (2011)Formula:C8H10N2O4Color and Shape:NeatMolecular weight:198.186-Nitrodopamine-d4
CAS:Controlled ProductApplications 6-Nitrodopamine-d4 is the labeled analogue of 6-Nitrodopamine(N493722), a reagent used in the detection of cancer biomarker prostate specific antigen (PSA).
References Li, H., et. al.: Biosensors Bioelectronics, 26, 3044 (2011)Formula:C8H6D4N2O4Color and Shape:NeatMolecular weight:202.26-Nitrodopamine-d4
CAS:Controlled Product6-Nitrodopamine-d4 is a stable isotope that can be used to study the metabolism of drugs. It is a precursor for the production of fatty acids and industrial preparations. 6-Nitrodopamine-d4 has been shown to have synergistic interactions with superparamagnetic iron. The hydroxyl group on 6-Nitrodopamine-d4 can react with nucleophilic attack, forming reaction products such as dopamine. This drug inhibits catechol-o-methyltransferase and striatal dopamine, which may contribute to its anti Parkinson’s disease effects.Formula:C8H10N2O4Purity:Min. 95%Molecular weight:198.18 g/mol



