CAS 21586-25-4

7-Bromothieno[3,2-d]pyrimidine

Description:

7-Bromothieno[3,2-d]pyrimidine is a heterocyclic compound characterized by the presence of both a thieno and a pyrimidine ring system, with a bromine substituent at the 7-position of the thieno ring. This compound typically exhibits a fused bicyclic structure, which contributes to its unique chemical properties. It is known for its potential applications in medicinal chemistry, particularly as a scaffold for the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the bromine atom can enhance its reactivity and influence its solubility and stability. Additionally, 7-Bromothieno[3,2-d]pyrimidine may exhibit interesting electronic properties due to the conjugated system formed by the fused rings. Its synthesis often involves methods such as halogenation and cyclization reactions. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, making it a versatile compound in organic synthesis.

Formula: C₆H₃BrN₂S

InChI: InChI=1/C6H3BrN2S/c7-4-2-10-5-1-8-3-9-6(4)5/h1-3H

SMILES: c1c2c(c(cs2)Br)ncn1

Synonyms:

• Thieno[3,2-d]pyrimidine, 7-bromo-

7-Bromothieno[3,2-d]pyrimidine

CAS: 21586-25-4

Formula: C₆H₃BrN₂S

Molecular weight: 215.0704

Ref: IN-DA0070LR

7-Bromothieno[3,2-d]pyrimidine

CAS: 21586-25-4

7-Bromothieno[3,2-d]pyrimidine

Purity: 98%

Molecular weight: 215.07g/mol

Ref: 54-OR930033