CAS 21586-90-3
:(1β,2α,11β,12α,15β)-13,20-Epoxy-1,2,11,12,14,15-hexahydroxypicras-3-en-16-one
Description:
The chemical substance known as "(1β,2α,11β,12α,15β)-13,20-Epoxy-1,2,11,12,14,15-hexahydroxypicras-3-en-16-one," with the CAS number 21586-90-3, is a complex organic compound characterized by its unique structural features, including multiple hydroxyl groups and an epoxy functional group. This compound belongs to a class of natural products known as alkaloids, which are often derived from plant sources and exhibit a range of biological activities. Its molecular structure suggests potential interactions with biological systems, making it of interest in pharmacological research. The presence of multiple stereocenters indicates that it may exist in different stereoisomeric forms, which can influence its reactivity and biological properties. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, particularly the epoxy and hydroxyl groups. Overall, this substance represents a fascinating area of study within organic chemistry and natural product research, with potential implications for medicinal chemistry and therapeutic applications.
Formula:C20H28O9
InChI:InChI=1S/C20H28O9/c1-7-4-9(21)13(23)17(2)8(7)5-10-19-6-28-18(3,14(24)11(22)12(17)19)20(19,27)15(25)16(26)29-10/h4,8-15,21-25,27H,5-6H2,1-3H3/t8-,9-,10+,11+,12+,13+,14-,15-,17-,18+,19+,20+/m0/s1
InChI key:InChIKey=ZBXITHPYBBXZRG-QYUWQHSUSA-N
SMILES:O[C@]12[C@@]34[C@@]([C@]5(C)[C@@](C[C@]3(OC(=O)[C@@H]1O)[H])(C(C)=C[C@H](O)[C@H]5O)[H])([C@@H](O)[C@H](O)[C@@]2(C)OC4)[H]
Synonyms:- 5H-3,11cβ-(Epoxymethano)phenanthro[10,1-bc]pyran-5-one, 1,2,3,3a,4,6aβ,7,7aα,10,11,11a,11bα-dodecahydro-1β,2α,3aβ,4β,10α,11β-hexahydroxy-3α,8,11aβ-trimethyl-, (+)-
- Picras-3-en-16-one, 13,20-epoxy-1,2,11,12,14,15-hexahydroxy-, (1β,2α,11β,12α,15β)-
- Bruceine E
- (1β,2α,11β,12α,15β)-13,20-Epoxy-1,2,11,12,14,15-hexahydroxypicras-3-en-16-one
- WST 63
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Bruceine E
CAS:Bruceine E is isolated from B. javanica seeds with hypoglycemia effects. Bruceine E can be used for studies about acting as an insulin secretagogue.Formula:C20H28O9Purity:99.88%Color and Shape:SolidMolecular weight:412.43Ref: TM-TN1128
1mg50.00€5mg105.00€10mg160.00€25mg261.00€50mg379.00€100mg528.00€200mg717.00€1mL*10mM (DMSO)123.00€Bruceine E
CAS:Bruceine E is a quassinoid compound, which is derived from the seeds of the Brucea javanica plant. This compound belongs to the class of naturally occurring compounds known as quassinoids, which are primarily sourced from Simaroubaceae family plants. Bruceine E exhibits a mode of action that involves the inhibition of specific molecular targets, leading to disruption in cellular processes essential for cancer cell survival and proliferation. Its mechanism is characterized by interference with DNA synthesis and induction of apoptosis in specific tumor cells.
Formula:C20H28O9Purity:Min. 95%Molecular weight:412.44 g/mol





