CAS 21586-90-3

(1β,2α,11β,12α,15β)-13,20-Epoxy-1,2,11,12,14,15-hexahydroxypicras-3-en-16-one

Description:

The chemical substance known as "(1β,2α,11β,12α,15β)-13,20-Epoxy-1,2,11,12,14,15-hexahydroxypicras-3-en-16-one," with the CAS number 21586-90-3, is a complex organic compound characterized by its unique structural features, including multiple hydroxyl groups and an epoxy functional group. This compound belongs to a class of natural products known as alkaloids, which are often derived from plant sources and exhibit a range of biological activities. Its molecular structure suggests potential interactions with biological systems, making it of interest in pharmacological research. The presence of multiple stereocenters indicates that it may exist in different stereoisomeric forms, which can influence its reactivity and biological properties. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, particularly the epoxy and hydroxyl groups. Overall, this substance represents a fascinating area of study within organic chemistry and natural product research, with potential implications for medicinal chemistry and therapeutic applications.

Formula: C₂₀H₂₈O₉

InChI: InChI=1S/C20H28O9/c1-7-4-9(21)13(23)17(2)8(7)5-10-19-6-28-18(3,14(24)11(22)12(17)19)20(19,27)15(25)16(26)29-10/h4,8-15,21-25,27H,5-6H2,1-3H3/t8-,9-,10+,11+,12+,13+,14-,15-,17-,18+,19+,20+/m0/s1

InChI key: InChIKey=ZBXITHPYBBXZRG-QYUWQHSUSA-N

SMILES: O[C@]12[C@@]34[C@@]([C@]5(C)[C@@](C[C@]3(OC(=O)[C@@H]1O)[H])(C(C)=C[C@H](O)[C@H]5O)[H])([C@@H](O)[C@H](O)[C@@]2(C)OC4)[H]

Synonyms:

• 5H-3,11cβ-(Epoxymethano)phenanthro[10,1-bc]pyran-5-one, 1,2,3,3a,4,6aβ,7,7aα,10,11,11a,11bα-dodecahydro-1β,2α,3aβ,4β,10α,11β-hexahydroxy-3α,8,11aβ-trimethyl-, (+)-
• Picras-3-en-16-one, 13,20-epoxy-1,2,11,12,14,15-hexahydroxy-, (1β,2α,11β,12α,15β)-
• Bruceine E
• (1β,2α,11β,12α,15β)-13,20-Epoxy-1,2,11,12,14,15-hexahydroxypicras-3-en-16-one
• WST 63

Bruceine E

CAS: 21586-90-3

Formula: C₂₀H₂₈O₉

Purity: 95%

Color and Shape: Solid

Molecular weight: 412.4309

Ref: IN-DA00BHMS

Bruceine E

CAS: 21586-90-3

Bruceine E

Purity: ≥98%

Molecular weight: 412.43g/mol

Ref: 54-BUP07283

Bruceine E

CAS: 21586-90-3

Formula: C₂₀H₂₈O₉

Molecular weight: 412.44

Ref: 7W-GY3764

Bruceine E

CAS: 21586-90-3

Bruceine E is isolated from B. javanica seeds with hypoglycemia effects. Bruceine E can be used for studies about acting as an insulin secretagogue.

Formula: C₂₀H₂₈O₉

Purity: 99.88%

Color and Shape: Solid

Molecular weight: 412.43

Ref: TM-TN1128

Bruceine E

CAS: 21586-90-3

Formula: C₂₀H₂₈O₉

Purity: 95%~99%

Molecular weight: 412.435

Ref: BP-BP4225

Bruceine E

CAS: 21586-90-3

Bruceine E is a quassinoid compound, which is derived from the seeds of the Brucea javanica plant. This compound belongs to the class of naturally occurring compounds known as quassinoids, which are primarily sourced from Simaroubaceae family plants. Bruceine E exhibits a mode of action that involves the inhibition of specific molecular targets, leading to disruption in cellular processes essential for cancer cell survival and proliferation. Its mechanism is characterized by interference with DNA synthesis and induction of apoptosis in specific tumor cells.

Formula: C₂₀H₂₈O₉

Purity: Min. 95%

Molecular weight: 412.44 g/mol

Ref: 3D-WAA58690