CAS 21587-74-6

3,9-Bis(3-aminopropyl)-2,4,8,10-tetraoxaspiro[5.5]undecane

Description:

3,9-Bis(3-aminopropyl)-2,4,8,10-tetraoxaspiro[5.5]undecane, with CAS number 21587-74-6, is a chemical compound characterized by its unique spirocyclic structure, which incorporates multiple ether linkages and amine functional groups. This compound features a spiro configuration that contributes to its three-dimensional shape, potentially influencing its reactivity and interactions with other molecules. The presence of the aminopropyl groups suggests that it may exhibit basic properties and can participate in various chemical reactions, such as nucleophilic substitutions or polymerization processes. Additionally, the tetraoxaspiro structure may impart stability and solubility characteristics, making it of interest in materials science and medicinal chemistry. Its specific applications could range from being a building block in polymer synthesis to potential uses in drug delivery systems, depending on its biological compatibility and reactivity. Overall, the compound's unique structural features and functional groups make it a subject of interest for further research in various chemical and industrial applications.

Formula: C₁₃H₂₆N₂O₄

InChI: InChI=1S/C13H26N2O4/c14-5-1-3-11-16-7-13(8-17-11)9-18-12(19-10-13)4-2-6-15/h11-12H,1-10,14-15H2

InChI key: InChIKey=ANOPCGQVRXJHHD-UHFFFAOYSA-N

SMILES: C(CCN)C1OCC2(COC(CCCN)OC2)CO1

Synonyms:

• Ajicure B 001
• 2,4,8,10-Tetraoxaspiro[5.5]undecane-3,9-bis(propylamine)
• 3,9-Bis(3-aminopropyl)-2,4,8,10-tetraoxaspiro[5.5]undecane
• 2,4,8,10-Tetraoxaspiro[5.5]undecane-3,9-dipropanamine
• Epomate B 001

3,9-Bis(3-aminopropyl)-2,4,8,10-tetraoxaspiro[5.5]undecane

CAS: 21587-74-6

Formula: C₁₃H₂₆N₂O₄

Color and Shape: Solid

Molecular weight: 274.3565

Ref: IN-DA003IR6

3,9-Bis(3-aminopropyl)-2,4,8,10-tetraoxaspiro[5.5]undecane

CAS: 21587-74-6

3,9-Bis(3-aminopropyl)-2,4,8,10-tetraoxaspiro[5.5]undecane (BAPTA) is a chemical compound that is used as a diagnostic agent in magnetic resonance imaging. 3,9-Bis(3-aminopropyl)-2,4,8,10-tetraoxaspiro[5.5]undecane binds to the hydroxyl group of aromatic hydrocarbons and alters their conformation so that they can be detected by MRI. BAPTA also has immunomodulatory properties and has been shown to have antiviral activity against human cytomegalovirus (HCMV) and Pseudomonas aeruginosa. BAPTA is also an aliphatic hydrocarbon with a polycarboxylic acid group on one end and an amine group on the other end.

Formula: C₁₃H₂₆N₂O₄

Purity: Min. 95%

Molecular weight: 274.36 g/mol

Ref: 3D-WAA58774