CAS 215928-66-8

6-(4-Chlorophenyl)thieno[3,2-d]pyrimidin-4(3H)-one

Description:

6-(4-Chlorophenyl)thieno[3,2-d]pyrimidin-4(3H)-one is a heterocyclic compound characterized by its unique structural features, which include a thieno[3,2-d]pyrimidine core fused with a chlorophenyl group. This compound typically exhibits a molecular formula that reflects its complex structure, incorporating elements such as carbon, hydrogen, nitrogen, sulfur, and chlorine. The presence of the thieno and pyrimidine rings contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The chlorophenyl substituent can influence the compound's lipophilicity and biological interactions, potentially enhancing its efficacy as a drug candidate. Additionally, this compound may exhibit specific physical properties such as solubility in organic solvents and stability under certain conditions, which are important for its application in research and development. Overall, 6-(4-Chlorophenyl)thieno[3,2-d]pyrimidin-4(3H)-one represents a class of compounds that may have significant implications in drug discovery and development.

Formula: C₁₂H₇ClN₂OS

InChI: InChI=1S/C12H7ClN2OS/c13-8-3-1-7(2-4-8)10-5-9-11(17-10)12(16)15-6-14-9/h1-6H,(H,14,15,16)

InChI key: InChIKey=GMVVGUVTWOTQNB-UHFFFAOYSA-N

SMILES: O=C1C=2SC(=CC2NC=N1)C3=CC=C(Cl)C=C3

Synonyms:

• Thieno[3,2-d]pyrimidin-4(1H)-one, 6-(4-chlorophenyl)-
• 6-(4-Chloro-phenyl)-3H-thieno[3,2-d]pyrimidin-4-one
• Thieno[3,2-d]pyrimidin-4(3H)-one, 6-(4-chlorophenyl)-
• 6-(4-Chlorophenyl)thieno[3,2-d]pyrimidin-4(3H)-one

6-(4-Chlorophenyl)-3,4-dihydrothieno[3,2-d]-pyrimidin-4-one

CAS: 215928-66-8

Color and Shape: Solid

Molecular weight: 262.7099914550781

Ref: 10-F017000

6-(4-Chlorophenyl)thieno[3,2-d]pyrimidin-4(3H)-one

CAS: 215928-66-8

6-(4-Chlorophenyl)thieno[3,2-d]pyrimidin-4(3H)-one is an organic compound that belongs to the group of inorganic acids. It has a ring structure with a carbonyl group and an aromatic ring system. 6-(4-Chlorophenyl)thieno[3,2-d]pyrimidin-4(3H)-one inhibits the production of cyclic nucleotides such as cAMP and cGMP, which are involved in the regulation of many cellular processes such as blood pressure. This inhibition leads to the reduction of heart rate and lowering blood pressure. 6-(4-Chlorophenyl)thieno[3,2-d]pyrimidin-4(3H)-one also has neuroinflammatory properties that may be due to its inhibition of prostaglandin synthesis.

Formula: C₁₂H₇ClN₂OS

Purity: Min. 95%

Molecular weight: 262.72 g/mol

Ref: 3D-QIA92866