CAS 21598-08-3
:benzo[d]oxazole-2-carboxylic acid
Description:
Benzo[d]oxazole-2-carboxylic acid is an organic compound characterized by its fused benzene and oxazole rings, which contribute to its aromatic properties. This compound features a carboxylic acid functional group at the 2-position of the oxazole ring, making it a heterocyclic aromatic carboxylic acid. It is typically a white to off-white solid and is soluble in polar organic solvents. The presence of both the benzene and oxazole rings imparts unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The compound may exhibit biological activity, potentially serving as a scaffold for drug development. Its structure allows for various chemical modifications, which can enhance its reactivity or solubility. Additionally, benzo[d]oxazole-2-carboxylic acid can participate in various chemical reactions, such as esterification and amidation, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H5NO3
InChI:InChI=1/C8H8FN.ClH/c9-8-3-1-2-6-4-10-5-7(6)8;/h1-3,10H,4-5H2;1H
SMILES:c1cc2CNCc2c(c1)F.Cl
Synonyms:- 2-Benzoxazolecarboxylic Acid
- Benzooxazole-2-carboxylic acid
- 1,3-Benzoxazole-2-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
cBenzooxazole-2-carboxylic acid
CAS:Benzooxazole-2-carboxylic acid is a chemical compound that has been studied for its potential in the treatment of cancer. It has been shown to bind to estrogen receptors and inhibit the growth of cancer cells. This anti-cancer agent also inhibits the growth of bacteria by binding to metal ions, such as chloride, which are needed for bacterial growth. Benzooxazole-2-carboxylic acid is excreted via urine, which can lead to kidney damage if taken in high doses.Formula:C8H5NO3Purity:Min. 95%Molecular weight:163.13 g/mol

