CAS 21599-36-0

2-Amino-7,8-dihydro-5(6H)-quinazolinone

Description:

2-Amino-7,8-dihydro-5(6H)-quinazolinone, with the CAS number 21599-36-0, is a heterocyclic organic compound characterized by its quinazolinone structure, which features a fused benzene and pyrimidine ring system. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, reflecting its polar functional groups. The presence of an amino group contributes to its basicity and potential reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions. It is often studied for its biological activities, including potential applications in pharmaceuticals, as it may exhibit antimicrobial, anti-inflammatory, or anticancer properties. The compound's stability and reactivity can be influenced by the presence of substituents on the ring, making it a subject of interest in medicinal chemistry and drug design. Overall, 2-Amino-7,8-dihydro-5(6H)-quinazolinone represents a versatile scaffold for further chemical modifications and investigations in various fields of research.

Formula: C₈H₉N₃O

InChI: InChI=1S/C8H9N3O/c9-8-10-4-5-6(11-8)2-1-3-7(5)12/h4H,1-3H2,(H2,9,10,11)

InChI key: InChIKey=ZXWJMLMXKMSYTP-UHFFFAOYSA-N

SMILES: O=C1C=2C(=NC(N)=NC2)CCC1

Synonyms:

• 2-Amino-7,8-dihydro-6H-quinazolin-5-one
• 5(6H)-Quinazolinone, 2-amino-7,8-dihydro-
• 2-Amino-5,6,7,8-tetrahydroquinazolin-5-one
• 2-Amino-7,8-dihydro-5(6H)-quinazolinone

2-AMINO-7,8-DIHYDROQUINAZOLIN-5-ONE

CAS: 21599-36-0

Formula: C₈H₉N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 163.1766

Ref: IN-DA00BI1G

2-Amino-7,8-dihydroquinazolin-5(6h)-one

CAS: 21599-36-0

2-Amino-7,8-dihydroquinazolin-5(6h)-one

Formula: C₈H₉N₃O

Purity: 95%

Color and Shape: yellow powder

Molecular weight: 163.18g/mol

Ref: 54-OR963736

2-Amino-7,8-dihydroquinazolin-5(6H)-one

CAS: 21599-36-0

2-Amino-7,8-dihydroquinazolin-5(6H)-one is a research chemical that belongs to the group of quinazolinones. It is a useful building block for the synthesis of other compounds. This compound can be reacted with various reagents to form new compounds. 2-Amino-7,8-dihydroquinazolin-5(6H)-one has been used as a starting material in the synthesis of PET imaging agents for diagnostic and therapeutic purposes. This compound is also used as a reaction component in organic chemistry research.

Formula: C₈H₉N₃O

Purity: Min. 95%

Color and Shape: Off-White Powder

Molecular weight: 163.18 g/mol

Ref: 3D-FA125614

2-AMINO-7,8-DIHYDROQUINAZOLIN-5-ONE

CAS: 21599-36-0

Formula: C₈H₉N₃O

Purity: 98%

Molecular weight: 163.18

Ref: 10-F300918