CAS 21599-37-1

2-amino-7,7-dimethyl-7,8-dihydroquinazolin-5(6H)-one

Description:

2-amino-7,7-dimethyl-7,8-dihydroquinazolin-5(6H)-one is a heterocyclic organic compound characterized by its quinazoline structure, which features a fused bicyclic system containing both a benzene and a pyrimidine ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents, such as water and alcohols, due to the presence of amino and carbonyl functional groups. The presence of the amino group contributes to its basicity and potential reactivity in various chemical reactions, including nucleophilic substitutions. Additionally, the dimethyl groups enhance its lipophilicity, which may influence its biological activity and pharmacokinetic properties. This compound is of interest in medicinal chemistry and may exhibit various biological activities, making it a candidate for further research in drug development. Its CAS number, 21599-37-1, allows for easy identification and reference in chemical databases and literature.

Formula: C₁₀H₁₃N₃O

InChI: InChI=1/C10H13N3O/c1-10(2)3-7-6(8(14)4-10)5-12-9(11)13-7/h5H,3-4H2,1-2H3,(H2,11,12,13)

SMILES: CC1(C)Cc2c(c[nH]c(=N)n2)C(=O)C1

Synonyms:

• 5(6H)-quinazolinone, 2-amino-7,8-dihydro-7,7-dimethyl-

2-Amino-7,7-dimethyl-7,8-dihydroquinazolin-5(6h)-one

CAS: 21599-37-1

2-Amino-7,7-dimethyl-7,8-dihydroquinazolin-5(6h)-one

Purity: 95%

Molecular weight: 191.23g/mol

Ref: 54-OR925640