CAS 216018-58-5
:2,2':6',2''-terpyridine-4,4',4''-tricarboxylic acid
Description:
2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid is a complex organic compound characterized by its structure, which features a terpyridine backbone with three carboxylic acid functional groups. This compound is known for its ability to form coordination complexes with various metal ions, making it of interest in coordination chemistry and materials science. The presence of multiple carboxylic acid groups enhances its solubility in polar solvents and allows for potential applications in biological systems and as a ligand in metal-organic frameworks (MOFs). Additionally, the terpyridine moiety contributes to its photophysical properties, which can be exploited in sensors and electronic devices. The compound is typically synthesized through multi-step organic reactions, and its stability and reactivity can be influenced by the pH of the environment and the presence of metal ions. Overall, 2,2':6',2''-terpyridine-4,4',4''-tricarboxylic acid is a versatile compound with significant implications in various fields, including catalysis, drug delivery, and nanotechnology.
Formula:C18H11N3O6
InChI:InChI=1/C18H11N3O6/c22-16(23)9-1-3-19-12(5-9)14-7-11(18(26)27)8-15(21-14)13-6-10(17(24)25)2-4-20-13/h1-8H,(H,22,23)(H,24,25)(H,26,27)
SMILES:c1cnc(cc1C(=O)O)c1cc(cc(c2cc(ccn2)C(=O)O)n1)C(=O)O
Synonyms:- 2,2':6',2''-Terpyridin-4,4',4''-tricarbons?ure
- 216018-58-5
- Acide 2,2':6',2''-terpyridine-4,4',4''-tricarboxylique
- 2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid
- [2,2':6',2''-terpyridine]-4,4',4''-tricarboxylic acid
- 2,2':6',2"-terpyridine-4,4',4"-tricarboxylic
- :6&apos
- 2,6-bis(4-carboxypyridin-2-yl)pyridine-4-carboxylic acid
- 6',2''-TERPYRIDINE-4,4',4''-TRICARBOXYLIC ACID
- 6',2'']Terpyridine-4,4',4''-tricarboxylic acid triMethyl ester
- 2,2':6',2"-terpyridine-4,4',4"-tricarboxylic acid 98%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
[2,2':6',2''-Terpyridine]-4,4',4''-tricarboxylic acid
CAS:Formula:C18H11N3O6Purity:95%Color and Shape:SolidMolecular weight:365.2964[2,2':6',2''-Terpyridine]-4,4',4''-tricarboxylic acid
CAS:[2,2':6',2''-Terpyridine]-4,4',4''-tricarboxylic acidPurity:97%Molecular weight:365.30g/mol[2,2′:6′,2”-Terpyridine]-4,4′,4”-tricarboxylic acid
CAS:Formula:C18H11N3O6Purity:95%Color and Shape:SolidMolecular weight:365.3012,2':6',2'-Terpyridine-4,4',4''-tricarboxylic acid
CAS:2,2':6',2'-Terpyridine-4,4',4''-tricarboxylic acid is a model system that has been studied for its photochemical properties. In this molecule, there are two carboxyl groups and three pyridine rings. The molecule can be protonated easily by electron transfer to form a positively charged anion. This allows the molecule to undergo electron transfer reactions with other molecules in the presence of radiation or visible light. 2,2':6',2'-Terpyridine-4,4',4''-tricarboxylic acid absorbs photons easily and then transfers its energy to a nearby electron. The electron then passes on the energy to another molecule, which can produce a photocurrent.
Formula:C18H11N3O6Purity:Min. 95%Color and Shape:Brown SolidMolecular weight:365.3 g/mol



