CAS 21603-70-3

ethyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate

Description:

Ethyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate is an organic compound characterized by its complex structure, which includes a pyrrole ring substituted with a formyl group and two methyl groups. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. Typically, compounds of this nature exhibit moderate polarity due to the presence of both hydrophobic (alkyl) and hydrophilic (carbonyl and ester) components. The pyrrole moiety often imparts unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the formyl group suggests potential reactivity in condensation reactions, while the ethyl ester can participate in esterification and hydrolysis. Additionally, the compound may exhibit biological activity, which is common among pyrrole derivatives, making it a subject of interest in medicinal chemistry. Overall, ethyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate is a versatile compound with potential applications in synthetic organic chemistry and drug development.

Formula: C₁₂H₁₇NO₃

InChI: InChI=1/C12H17NO3/c1-4-16-12(15)6-5-10-8(2)11(7-14)13-9(10)3/h7,13H,4-6H2,1-3H3

SMILES: CCOC(=O)CCc1c(C)c(C=O)[nH]c1C

Synonyms:

• 3-(2-Ethoxycarbonylethyl)-2,4-Dimethyl-5-Formylpyrrole

Ethyl 3-(2,4-dimethyl-5-formyl-1H-pyrrol-3-yl)propanoate

CAS: 21603-70-3

Ethyl 3-(2,4-dimethyl-5-formyl-1H-pyrrol-3-yl)propanoate

Purity: ≥95%

Color and Shape: Brown Solid

Molecular weight: 223.27g/mol

Ref: 54-OR8264