CAS 216059-95-9

Benzoic acid,4-(8-quinolinyl)-

Description:

Benzoic acid, 4-(8-quinolinyl)-, is an organic compound characterized by its benzoic acid structure modified with a quinoline moiety at the para position. This compound typically exhibits properties associated with both benzoic acid and quinoline derivatives, including potential acidity due to the carboxylic acid functional group. It is likely to be a solid at room temperature, with moderate solubility in organic solvents and limited solubility in water, reflecting the hydrophobic nature of the quinoline ring. The presence of the quinoline structure may impart biological activity, making it of interest in pharmaceutical research. Additionally, this compound may exhibit UV absorbance due to the conjugated system of the quinoline, which can be useful in analytical applications. Its chemical behavior can be influenced by the functional groups present, allowing for various reactions typical of carboxylic acids and heterocyclic compounds. Overall, benzoic acid, 4-(8-quinolinyl)-, represents a unique intersection of aromatic chemistry and potential biological relevance.

Formula: C₁₆H₁₁NO₂

InChI: InChI=1S/C16H11NO2/c18-16(19)13-8-6-11(7-9-13)14-5-1-3-12-4-2-10-17-15(12)14/h1-10H,(H,18,19)

InChI key: InChIKey=ZHVGZDKFCXKGQH-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC=C(C=2C3=C(C=CC2)C=CC=N3)C=C1

Synonyms:

• 4-(8-Quinolinyl)benzoic acid
• 4-(Quinolin-8-yl)benzoic acid
• Benzoic acid, 4-(8-quinolinyl)-

4-(Quinolin-8-yl)benzoic acid

CAS: 216059-95-9

Versatile small molecule scaffold

Formula: C₁₆H₁₁NO₂

Purity: Min. 95%

Molecular weight: 249.26 g/mol

Ref: 3D-RIA05995