CymitQuimica logo

CAS 216087-92-2

:

2H-Pyran-4-methanol, tetrahydro-a-phenyl-

Description:
2H-Pyran-4-methanol, tetrahydro-α-phenyl- is an organic compound characterized by its pyran ring structure, which is a six-membered heterocyclic compound containing one oxygen atom. This substance features a methanol group (-CH2OH) at the 4-position of the pyran ring and a tetrahydro-α-phenyl substituent, indicating the presence of a phenyl group attached to a saturated carbon framework. The compound is likely to exhibit properties typical of both pyran derivatives and alcohols, such as solubility in polar solvents due to the hydroxyl group and potential reactivity in various chemical reactions, including oxidation and substitution. Its molecular structure suggests it may participate in hydrogen bonding, influencing its physical properties like boiling and melting points. Additionally, the presence of the phenyl group may impart aromatic characteristics, affecting its stability and reactivity. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on further empirical studies.
Formula:C12H16O2
InChI:InChI=1S/C12H16O2/c13-12(10-4-2-1-3-5-10)11-6-8-14-9-7-11/h1-5,11-13H,6-9H2
InChI key:DAXAFMSSNPTLPA-UHFFFAOYSA-N
SMILES:C1COCCC1C(C2=CC=CC=C2)O
Found 4 products.