CAS 21618-67-7
:5-(trifluoromethyl)uridine
Description:
5-(Trifluoromethyl)uridine is a modified nucleoside that features a trifluoromethyl group attached to the uridine structure. This compound is characterized by its unique fluorinated substituent, which can significantly influence its chemical properties, biological activity, and interactions with nucleic acids. The trifluoromethyl group enhances lipophilicity and can affect the compound's stability and reactivity. As a derivative of uridine, it retains the essential pyrimidine base structure, which is crucial for its role in nucleic acid synthesis and function. The presence of the trifluoromethyl group may also impart unique pharmacological properties, making it of interest in medicinal chemistry and drug development. Additionally, 5-(trifluoromethyl)uridine can be utilized in various biochemical applications, including studies on RNA behavior and the development of antiviral agents. Its CAS number, 21618-67-7, allows for precise identification and retrieval of information regarding its properties and applications in scientific literature.
Formula:C10H11F3N2O6
InChI:InChI=1/C10H11F3N2O6/c11-10(12,13)3-1-15(9(20)14-7(3)19)8-6(18)5(17)4(2-16)21-8/h1,4-6,8,16-18H,2H2,(H,14,19,20)/t4-,5-,6-,8-/m1/s1
SMILES:c1c(c(nc(=O)n1[C@H]1[C@@H]([C@@H]([C@@H](CO)O1)O)O)O)C(F)(F)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-(Trifluoromethyl)uridine
CAS:5-(Trifluoromethyl)uridine is a Nucleoside Derivative - Fluoro-modified nucleoside, 5-Modified pyrimidine nucleoside.Formula:C10H11F3N2O6Color and Shape:SolidMolecular weight:312.2Ref: TM-TNU0032
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire5-(Trifluoromethyl)uridine
CAS:Controlled ProductFormula:C10H11F3N2O6Color and Shape:NeatMolecular weight:312.1995-(Trifluoromethyl)uridine
CAS:5-(Trifluoromethyl)uridine is an experimental drug that inhibits protein synthesis in Mycobacterium avium. It binds to the cytidine deaminase enzyme, preventing it from converting cytidine to uridine. 5-Fluorouracil (5FU) is a pyrimidine nucleoside analog that is used in the chemotherapy of cancer. 5FU has been shown to have anti-cancer effects by inhibiting DNA synthesis and inducing apoptosis. This may be due to its ability to inhibit the growth factor erythropoietin, which is involved in cell proliferation.Formula:C10H11F3N2O6Purity:Min. 95%Molecular weight:312.2 g/mol


