CAS 21622-08-2
:1-Cyclopentene-1-acetic acid
Description:
1-Cyclopentene-1-acetic acid is an organic compound characterized by its cyclopentene ring structure with an acetic acid functional group. It features a double bond in the cyclopentene moiety, which contributes to its reactivity and potential for undergoing various chemical reactions, such as addition reactions. The presence of the acetic acid group introduces acidity, allowing it to participate in acid-base reactions. This compound is typically a colorless to pale yellow liquid at room temperature and has a distinctive odor. Its solubility in water is moderate, influenced by the polar nature of the acetic acid group, while it is more soluble in organic solvents. 1-Cyclopentene-1-acetic acid can be used in organic synthesis and may serve as an intermediate in the production of other chemical compounds. Safety precautions should be taken when handling this substance, as it may be irritant to skin and eyes. Overall, its unique structure and functional groups make it a valuable compound in various chemical applications.
Formula:C7H10O2
InChI:InChI=1S/C7H10O2/c8-7(9)5-6-3-1-2-4-6/h3H,1-2,4-5H2,(H,8,9)
InChI key:InChIKey=QOGMZIQMZUXOKM-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1CCCC1
Synonyms:- 1-Cyclopentene-1-acetic acid
- 1-Cyclopentenylacetic acid
- 2-(Cyclopent-1-en-1-yl)acetic acid
- Cyclopent-1-En-1-Ylacetic Acid
- Cyclopentene-1-acetic acid
- Cyclopent-1-ene-1-acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-(Cyclopent-1-en-1-yl)acetic acid
CAS:2-(Cyclopent-1-en-1-yl)acetic acid (CPEAA) is a molecule that is found in food. It is an alkoxy radical, which are molecules with oxygen atoms attached to an alicyclic carbon atom. CPEAA has been shown to have various health benefits when taken as a functional food additive. It can stimulate the uptake of glucose from the blood into cells and reduce insulin resistance. CPEAA also has beneficial effects on liver cells by reducing hepatic steatosis, or fatty liver disease, and tuberculatus, a type of tuberculosis caused by Mycobacterium tuberculosis. The biosynthesis of 2-(Cyclopent-1-en-1-yl)acetic acid begins with acetate and ends with cyclopentanol.Formula:C7H10O2Purity:Min. 95%Molecular weight:126.15 g/mol

