
CAS 216227-54-2
:N-[4-[2-[4-[3-Ethoxy-1(E)-propenyl]phenyl]-4-[4-(isopropylamino)phenyl]-1H-imidazol-5-yl]phenyl]-N-isopropylamine
Description:
N-[4-[2-[4-[3-Ethoxy-1(E)-propenyl]phenyl]-4-[4-(isopropylamino)phenyl]-1H-imidazol-5-yl]phenyl]-N-isopropylamine, with CAS number 216227-54-2, is a complex organic compound characterized by its multi-functional structure, which includes an imidazole ring and various aromatic groups. This compound features an ethoxy group and a propenyl moiety, contributing to its potential reactivity and biological activity. The presence of isopropylamine suggests possible interactions with biological systems, making it of interest in medicinal chemistry. Its structural complexity may influence its solubility, stability, and interaction with biological targets. The compound's synthesis and characterization would typically involve standard organic chemistry techniques, including chromatography and spectroscopy for purity and structural confirmation. Given its intricate design, it may exhibit specific pharmacological properties, potentially acting as a ligand or inhibitor in various biochemical pathways. Further studies would be necessary to elucidate its full range of characteristics, including its efficacy, safety, and potential applications in therapeutic contexts.
Formula:C32H38N4O
InChI:InChI=1/C32H38N4O/c1-6-37-21-7-8-24-9-11-27(12-10-24)32-35-30(25-13-17-28(18-14-25)33-22(2)3)31(36-32)26-15-19-29(20-16-26)34-23(4)5/h7-20,22-23,33-34H,6,21H2,1-5H3,(H,35,36)/b8-7+
Synonyms:- OC-144-093
- 4,4'-(2-{4-[(1E)-3-ethoxyprop-1-en-1-yl]phenyl}-1H-imidazole-4,5-diyl)bis[N-(1-methylethyl)aniline]
- OC144-093
- ONT-093
- 2-[4-[3-Ethoxy-1(E)-propenyl]phenyl]-4,5-bis[4-(isopropylamino)phenyl]-1H-imidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-[2-[4-[(E)-3-Ethoxyprop-1-enyl]phenyl]-4-[4-(propan-2-ylamino)phenyl]-1H-imidazol-5-yl]-N-propan-2-ylaniline
CAS:Controlled Product4-[2-[4-[(E)-3-Ethoxyprop-1-enyl]phenyl]-4-[4-(propan-2-ylamino)phenyl]-1H-imidazol-5-yl]-N-propan-2-ylaniline (BMS182874) is an inhibitor of the ATPase pump that is responsible for maintaining the integrity of the cell membrane, which is a key component in cancer therapy. The drug has been shown to inhibit tumor metastasis and tumor growth in animal models. BMS182874 also inhibits the insulin receptor signaling pathway, leading to insulin resistance and diabetes mellitus type 2. This drug has been shown to inhibit chaperone function, which may be due to its ability to bind to beta barrel structures, such as those found in HSP90 and HSP70 proteins. BMS182874 was originally designed as a diagnostic agent for prostate cancer and autoimmune diseases, but it hasFormula:C32H38N4OPurity:Min. 95%Molecular weight:494.7 g/molONT-093
CAS:ONT-093 (OC-144-093) is an oral P-glycoprotein (P-gp) inhibitor with potential anti-cancer activity, used in the study of myelodysplastic syndromes.Formula:C32H38N4OPurity:98.86%Color and Shape:SolidMolecular weight:494.67


