CymitQuimica logo

CAS 21629-48-1

:

7-Chloro-2,8-dimethyl-4-hydroxyquinoline

Description:
7-Chloro-2,8-dimethyl-4-hydroxyquinoline, with the CAS number 21629-48-1, is a chemical compound belonging to the quinoline family, characterized by a bicyclic structure containing a nitrogen atom. This compound features a chlorine atom at the 7-position and two methyl groups at the 2 and 8 positions, along with a hydroxyl group at the 4-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit varying solubility in organic solvents and water, depending on the specific conditions. The presence of the hydroxyl group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other chemical entities. As with many quinoline derivatives, it may exhibit antimicrobial or antimalarial properties, making it a subject of research in pharmacology. Proper handling and safety measures should be observed due to its chemical nature.
Formula:C11H10ClNO
InChI:InChI=1/C11H10ClNO/c1-6-5-10(14)8-3-4-9(12)7(2)11(8)13-6/h3-5H,1-2H3,(H,13,14)
InChI key:LOJPYUFGOCWEHF-UHFFFAOYSA-N
SMILES:Cc1cc(c2ccc(c(C)c2n1)Cl)O
Synonyms:
  • 7-chloro-2,8-dimethylquinolin-4(1H)-one
Found 3 products.