CAS 21633-59-0

N-(4-oxo-2-thioxo-1,3-thiazolidin-3-yl)acetamide

Description:

N-(4-oxo-2-thioxo-1,3-thiazolidin-3-yl)acetamide, with the CAS number 21633-59-0, is a thiazolidinone derivative characterized by its unique thiazolidine ring structure, which incorporates both sulfur and nitrogen atoms. This compound features a thioxo group, contributing to its reactivity and potential biological activity. The presence of the acetamide functional group suggests that it may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its solubility and interaction with biological targets. Thiazolidinones are often studied for their pharmacological properties, including antimicrobial and anti-inflammatory activities. The compound's structural features may allow it to participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and potential therapeutic applications. Overall, this compound represents a class of substances with significant potential for further research and application in various fields of chemistry and pharmacology.

Formula: C₅H₆N₂O₂S₂

InChI: InChI=1/C5H6N2O2S2/c1-3(8)6-7-4(9)2-11-5(7)10/h2H2,1H3,(H,6,8)

SMILES: CC(=NN1C(=O)CSC1=S)O

Synonyms:

• acetamide, N-(4-oxo-2-thioxo-3-thiazolidinyl)-
• N-(4-Oxo-2-thioxo-thiazolidin-3-yl)-acetamide
• N1-(4-oxo-2-thioxo-1,3-thiazolan-3-yl)acetamide

N-(4-Oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide

CAS: 21633-59-0

Versatile small molecule scaffold

Formula: C₅H₆N₂O₂S₂

Purity: Min. 95%

Molecular weight: 190.2 g/mol

Ref: 3D-WAA63359