CAS 21633-77-2
:1,3-Diethyl 2-(1-oxopropyl)propanedioate
Description:
1,3-Diethyl 2-(1-oxopropyl)propanedioate, with the CAS number 21633-77-2, is an organic compound characterized by its diester structure, which features two ethyl groups and a ketone functionality. This compound belongs to the class of propanedioates, specifically diesters derived from malonic acid. It typically exhibits a colorless to pale yellow appearance and is soluble in organic solvents due to its ester groups. The presence of the 1-oxopropyl substituent introduces a ketone functionality, which can influence its reactivity and potential applications in organic synthesis. The compound may participate in various chemical reactions, including esterification and condensation reactions, making it useful in the synthesis of more complex organic molecules. Its properties, such as boiling point, melting point, and specific reactivity, can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C10H16O5
InChI:InChI=1S/C10H16O5/c1-4-7(11)8(9(12)14-5-2)10(13)15-6-3/h8H,4-6H2,1-3H3
InChI key:InChIKey=DOYKFDRIECFSJW-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(C(OCC)=O)C(CC)=O
Synonyms:- 1,3-Diethyl 2-(1-oxopropyl)propanedioate
- 1,3-Diethyl 2-propanoylpropanedioate
- 2-(Ethoxycarbonyl)-3-oxopentanoic acid ethyl ester
- Diethyl .alpha.-propionylmalonate
- Diethyl 2-(propanoyl)propanedioate
- Diethyl propionylmalonate
- Diethyl α-propionylmalonate
- Malonic acid, propionyl-, diethyl ester
- NSC 15401
- Propanedioic Acid, 2-(1-Oxopropyl)-, Diethyl Ester
- Propanedioic acid, (1-oxopropyl)-, diethyl ester
- Propanedioic acid, (1-oxopropyl)-, diethyl ester (9CI)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1,3-Diethyl 2-propanoylpropanedioate
CAS:1,3-Diethyl 2-propanoylpropanedioate is a chiral drug that can be used for the treatment of respiratory diseases. It acts by inhibiting the muscarinic acetylcholine receptors in the lungs, which prevents bronchoconstriction and reduces mucus production. 1,3-Diethyl 2-propanoylpropanedioate is an active substance that belongs to a group of c1-6 alkyl drugs labeled with radioactive iodine-131. The labeling process involves substituting an atom of either carbon or hydrogen with an atom of iodine-131 to create a radioactive compound. This process can be used to identify substances that have similar properties, such as immunoassays and pharmacophores. The main difference between 1,3-diethyl 2-propanoylpropanedioate and its geometric isomers is the orientation of two methyl groups on the propanediol molecule. TheFormula:C10H16O5Purity:Min. 95%Molecular weight:216.23 g/mol
