CymitQuimica logo

CAS 21633-78-3

:

diethyl (2-methylpropanoyl)propanedioate

Description:
Diethyl (2-methylpropanoyl)propanedioate, with the CAS number 21633-78-3, is an organic compound that belongs to the class of diesters. It features two ethyl ester groups attached to a central propanedioate moiety, which is further substituted with a 2-methylpropanoyl group. This compound is characterized by its relatively low molecular weight and the presence of multiple functional groups, including ester linkages, which contribute to its reactivity and solubility in organic solvents. Diethyl (2-methylpropanoyl)propanedioate is typically a colorless to pale yellow liquid, exhibiting a pleasant odor. It is used in various applications, including as an intermediate in organic synthesis and potentially in the production of pharmaceuticals or agrochemicals. The compound's structure allows for potential reactivity in condensation reactions, making it valuable in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H18O5
InChI:InChI=1/C11H18O5/c1-5-15-10(13)8(9(12)7(3)4)11(14)16-6-2/h7-8H,5-6H2,1-4H3
InChI key:CBFJLYQEACAOLC-UHFFFAOYSA-N
SMILES:CCOC(=O)C(C(=O)C(C)C)C(=O)OCC
Found 5 products.