CAS 21635-78-9
:N-ethyl-N-ethoxylethyl-4-amino benzaldehyde
Description:
N-ethyl-N-ethoxylethyl-4-amino benzaldehyde, identified by its CAS number 21635-78-9, is an organic compound characterized by its functional groups and structural features. It contains an amino group (-NH2) attached to a benzaldehyde moiety, which is a benzene ring with an aldehyde group (-CHO) at the para position relative to the amino group. The presence of ethyl and ethoxy substituents contributes to its unique properties, influencing its solubility, reactivity, and potential applications in organic synthesis or as an intermediate in pharmaceuticals. The compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic and hydrophilic functional groups. Its reactivity may include typical reactions of aldehydes and amines, such as nucleophilic addition and condensation reactions. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound's structure suggests potential utility in various chemical applications, particularly in the synthesis of more complex organic molecules.
Formula:C13H19NO2
InChI:InChI=1/C13H19NO2/c1-3-14(9-10-16-4-2)13-7-5-12(11-15)6-8-13/h5-8,11H,3-4,9-10H2,1-2H3
SMILES:CCN(CCOCC)c1ccc(cc1)C=O
Synonyms:- 4-[(2-Ethoxyethyl)(ethyl)amino]benzaldehyde
- Benzaldehyde, 4-[(2-Ethoxyethyl)Ethylamino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
