CAS 21638-14-2

1-Azabicyclo[2.2.2]octan-3-amine, 3-methyl-, hydrochloride (1:2)

Description:

1-Azabicyclo[2.2.2]octan-3-amine, 3-methyl-, hydrochloride (1:2), commonly referred to as a bicyclic amine, is a chemical compound characterized by its bicyclic structure, which consists of a nitrogen atom incorporated into a saturated ring system. This compound features a tertiary amine functional group, contributing to its basicity and potential for forming salts, such as the hydrochloride form indicated in its name. The presence of the methyl group at the 3-position enhances its steric properties and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit properties typical of amines, such as nucleophilicity and the ability to participate in hydrogen bonding. Its unique structure and functional groups suggest potential uses in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other biological pathways. Safety and handling precautions should be observed due to its chemical nature.

Formula: C₈H₁₆N₂·2ClH

InChI: InChI=1S/C8H16N2.2ClH/c1-8(9)6-10-4-2-7(8)3-5-10;;/h7H,2-6,9H2,1H3;2*1H

InChI key: InChIKey=RNNWAJOABQOPSX-UHFFFAOYSA-N

SMILES: CC1(N)C2CCN(C1)CC2.Cl

Synonyms:

• Quinuclidine, 3-amino-3-methyl-, dihydrochloride
• 3-Methyl-1-azabicyclo[2.2.2]octan-3-amine dihydrochloride
• 1-Azabicyclo[2.2.2]octan-3-amine, 3-methyl-, hydrochloride (1:2)

3-Methyl-1-azabicyclo[2.2.2]octan-3-amine dihydrochloride

CAS: 21638-14-2

Versatile small molecule scaffold

Formula: C₈H₁₈Cl₂N₂

Purity: Min. 95%

Molecular weight: 213.15 g/mol

Ref: 3D-WAA63814