CymitQuimica logo

CAS 216393-57-6

:

3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester

Description:
3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester is a chemical compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. The compound features a difluorobenzene ring, indicating the substitution of two fluorine atoms at the 3 and 5 positions, which can influence its electronic properties and reactivity. The incorporation of neopentyl glycol in a cyclic ester form suggests that the compound may exhibit unique solubility and stability characteristics, potentially enhancing its utility in organic synthesis and medicinal chemistry. Boronic acids are often used in Suzuki coupling reactions, making this compound potentially valuable in the synthesis of complex organic molecules. Additionally, the presence of fluorine atoms can enhance lipophilicity and biological activity, making it of interest in pharmaceutical applications. Overall, this compound combines features that may contribute to its reactivity, stability, and potential applications in various chemical processes.
Formula:C11H13BF2O2
InChI:InChI=1/C11H13BF2O2/c1-11(2)6-15-12(16-7-11)8-3-9(13)5-10(14)4-8/h3-5H,6-7H2,1-2H3
InChI key:OLHRAEPCGZMMTI-UHFFFAOYSA-N
SMILES:CC1(C)COB(c2cc(cc(c2)F)F)OC1
Synonyms:
  • 2-(3,5-Difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane
Found 4 products.