CAS 216393-63-4
:5-Isopropyl-2-methoxybenzeneboronic acid
Description:
5-Isopropyl-2-methoxybenzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a substituted aromatic ring. The compound features an isopropyl group and a methoxy group on the benzene ring, which influence its reactivity and solubility. Typically, boronic acids are known for their ability to form reversible complexes with diols, making them valuable in organic synthesis, particularly in cross-coupling reactions such as Suzuki-Miyaura coupling. The presence of the isopropyl and methoxy substituents can enhance the compound's lipophilicity and may affect its electronic properties, potentially influencing its reactivity in various chemical transformations. Additionally, boronic acids are often utilized in medicinal chemistry for drug development due to their ability to interact with biological targets. The compound's stability, solubility in organic solvents, and reactivity with electrophiles or nucleophiles are key characteristics that define its utility in synthetic applications.
Formula:C10H15BO3
InChI:InChI=1/C10H15BO3/c1-7(2)8-4-5-10(14-3)9(6-8)11(12)13/h4-7,12-13H,1-3H3
SMILES:CC(C)c1ccc(c(c1)B(O)O)OC
Synonyms:- (5-Isopropyl-2-methoxyphenyl)boronic acid
- boronic acid, B-[2-methoxy-5-(1-methylethyl)phenyl]-
- [2-Methoxy-5-(1-Methylethyl)Phenyl]Boronic Acid
- 5-Isopropyl-2-methoxyphenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Isopropyl-2-methoxybenzeneboronic acid, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H15BO3Purity:98+%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:194.04(5-Isopropyl-2-methoxyphenyl)boronic acid
CAS:Formula:C10H15BO3Purity:98%Color and Shape:SolidMolecular weight:194.03535-Isopropyl-2-methoxyphenylboronic acid
CAS:5-Isopropyl-2-methoxyphenylboronic acidPurity:98%Molecular weight:194.04g/mol



