CAS 216394-05-7
:5-Bromo-6-chloro-3-pyridinesulfonyl chloride
Description:
5-Bromo-6-chloro-3-pyridinesulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features a pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen, contributing to its unique chemical properties. The presence of both bromine and chlorine substituents on the pyridine ring enhances its electrophilic character, making it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. The sulfonyl chloride group is particularly reactive, allowing for the formation of sulfonamides and other derivatives through nucleophilic substitution reactions. This compound is typically handled with care due to its potential to release toxic gases upon hydrolysis and its corrosive nature. It is important to store it in a cool, dry place, away from moisture and incompatible substances. Overall, 5-Bromo-6-chloro-3-pyridinesulfonyl chloride is a versatile reagent in synthetic organic chemistry, particularly in the development of biologically active compounds.
Formula:C5H2BrCl2NO2S
InChI:InChI=1S/C5H2BrCl2NO2S/c6-4-1-3(12(8,10)11)2-9-5(4)7/h1-2H
InChI key:InChIKey=TURGMVYIESHZBE-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1C=C(Br)C(Cl)=NC1
Synonyms:- 3-Bromo-2-chloropyridine-5-sulfonyl chloride
- 3-Pyridinesulfonyl chloride, 5-bromo-6-chloro-
- 5-Bromo-6-Chloropyridine-3-Sulfonyl Chloride
- 5-Bromo-6-chloro-3-pyridinesulfonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Bromo-2-chloropyridine-5-sulfonyl chloride, 96%
CAS:3-Bromo-2-chloropyridine-5-sulfonyl chloride is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff field. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and labeFormula:C5H2BrCl2NO2SPurity:96%Color and Shape:White to cream to yellow, Powder or crystalline powderMolecular weight:290.955-bromo-6-chloropyridine-3-sulfonyl chloride
CAS:Formula:C5H2BrCl2NO2SPurity:95%Color and Shape:SolidMolecular weight:290.94995-Bromo-6-chloropyridine-3-sulphonyl chloride
CAS:5-Bromo-6-chloropyridine-3-sulphonyl chlorideFormula:C5H2BrCl2NO2SPurity:95%Color and Shape: off-white to faint yellow solidMolecular weight:290.95g/mol5-Bromo-6-chloro-3-pyridine sulfonyl chloride
CAS:Formula:C5H2BrCl2NO2SPurity:98%Color and Shape:Solid, No data available.Molecular weight:290.945-Bromo-6-chloropyridine-3-sulfonyl Chloride
CAS:Controlled ProductApplications 5-Bromo-6-chloropyridine-3-sulfonyl Chloride (cas# 216394-05-7) is a compound useful in organic synthesis.
Formula:C5H2BrCl2NO2SColor and Shape:NeatMolecular weight:290.95




