CAS 2164-61-6
:3-CARBOXYPYRIDAZINE
Description:
3-Carboxypyridazine is an organic compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 2. The presence of a carboxylic acid group (-COOH) at the 3-position of the pyridazine ring imparts acidic properties to the molecule. This compound is typically a white to off-white solid and is soluble in polar solvents due to the hydrophilic nature of the carboxylic acid group. 3-Carboxypyridazine can participate in various chemical reactions, including esterification and amidation, making it useful in synthetic organic chemistry. Its structural features allow it to potentially act as a ligand in coordination chemistry or as a building block in the synthesis of more complex molecules. Additionally, derivatives of pyridazine compounds have been studied for their biological activities, including antimicrobial and anti-inflammatory properties, although specific biological data for 3-carboxypyridazine may vary. Overall, this compound represents an interesting subject for further research in both synthetic and medicinal chemistry.
Formula:C5H4N2O2
InChI:InChI=1/C5H4N2O2/c8-5(9)4-2-1-3-6-7-4/h1-3H,(H,8,9)
SMILES:c1cc(C(=O)O)nnc1
Synonyms:- 3-Pyridazinecarboxylic acid
- Pyridazine-3-Carboxylic Acid
- 3-Pyridazinylcarboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Pyridazine-3-carboxylic acid, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C5H4N2O2Purity:97%Color and Shape:White to cream or yellow, PowderMolecular weight:124.103-Pyridazinecarboxylic acid
CAS:Formula:C5H4N2O2Purity:97%Color and Shape:SolidMolecular weight:124.0975Pyridazine-3-carboxylic acid
CAS:<p>Pyridazine-3-carboxylic acid</p>Formula:C5H4N2O2Purity:96%Color and Shape: light yellow to light orange solidMolecular weight:124.09746g/molPyridazine-3-carboxylic acid
CAS:Formula:C5H4N2O2Purity:97%Color and Shape:Off-white powderMolecular weight:124.099
