CAS 21658-35-5

3-(naphthalen-2-yl)propanoic acid

Description:

3-(Naphthalen-2-yl)propanoic acid, with the CAS number 21658-35-5, is an organic compound characterized by its structure, which features a propanoic acid moiety attached to a naphthalene ring. This compound typically appears as a white to off-white solid and is known for its aromatic properties due to the presence of the naphthalene group. It is soluble in organic solvents but has limited solubility in water, reflecting its hydrophobic nature. The presence of the carboxylic acid functional group (-COOH) imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. This compound may be utilized in organic synthesis and as an intermediate in the production of pharmaceuticals or other chemical products. Additionally, its structural features may contribute to specific biological activities, making it of interest in medicinal chemistry. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards.

Formula: C₁₃H₁₂O₂

InChI: InChI=1/C13H12O2/c14-13(15)8-6-10-5-7-11-3-1-2-4-12(11)9-10/h1-5,7,9H,6,8H2,(H,14,15)

SMILES: c1ccc2cc(ccc2c1)CCC(=O)O

Synonyms:

• 2-Naphthalenepropanoic Acid
• 3-(2-Naphthyl)propanoic acid

3-(Naphthalen-2-yl)propanoic acid

CAS: 21658-35-5

Formula: C₁₃H₁₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 200.2332

Ref: IN-DA003I19

2-Naphthalenepropanoic acid

CAS: 21658-35-5

2-Naphthalenepropanoic acid

Purity: 98%-102%

Molecular weight: 200.23g/mol

Ref: 54-OR927985

3-(Naphthalen-2-yl)propanoic acid

CAS: 21658-35-5

Formula: C₁₃H₁₂O₂

Purity: 95%

Molecular weight: 200.237

Ref: 10-F329040

3-(Naphthalen-2-yl)propanoic acid

CAS: 21658-35-5

3-(Naphthalen-2-yl)propanoic acid is a phenolic compound that has been shown to inhibit the activity of tyrosinase. Tyrosinase is an enzyme that catalyzes the first step in melanin synthesis and is known to play a role in skin pigmentation. 3-(Naphthalen-2-yl)propanoic acid inhibits tyrosinase by binding to its active site, thereby blocking it from catalyzing the conversion of tyrosine to dopaquinone. The compound also has inhibitory effects on melanoma cells, which may be due to its ability to decrease the production of melanin. 3-(Naphthalen-2-yl)propanoic acid is structurally similar to hydroquinone, but lacks hydroxyl groups on its aromatic ring.

Formula: C₁₃H₁₂O₂

Purity: Min. 95%

Molecular weight: 200.24 g/mol

Ref: 3D-WAA65835