CAS 21666-38-6
:n-Hexane-d{14}
Description:
n-Hexane-d14, with the CAS number 21666-38-6, is a deuterated form of n-hexane, a straight-chain alkane with six carbon atoms. The "d14" designation indicates that fourteen hydrogen atoms in the molecule have been replaced with deuterium, a stable isotope of hydrogen. This substitution alters the physical and chemical properties of the compound, making it useful in various applications, particularly in nuclear magnetic resonance (NMR) spectroscopy, where it serves as a solvent that minimizes interference from hydrogen signals. n-Hexane-d14 retains the general characteristics of n-hexane, such as being a colorless, flammable liquid with a low boiling point and high volatility. It is non-polar and insoluble in water, making it suitable for extracting non-polar compounds. The presence of deuterium can also enhance the stability of the molecule under certain conditions. Overall, n-Hexane-d14 is valuable in research and analytical chemistry, particularly in studies involving isotopic labeling and molecular dynamics.
Formula:C6D14
InChI:InChI=1/C6H14/c1-3-5-6-4-2/h3-6H2,1-2H3/i1D3,2D3,3D2,4D2,5D2,6D2
SMILES:C(C(C(C(C(C([2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])([2H])[2H]
Synonyms:- Hexane-d14
- (~2~H_14_)hexane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
n-Hexane-d{14}, 99%(Isotopic)
CAS:<p>n-Hexane-d{14} is a deuterium labeled n-hexane which is used as a organic intermediate in chemical research. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Al</p>Formula:CD3(CD2)4CD3Purity:99%Color and Shape:Liquid, Clear colorlessMolecular weight:100.29n-Hexane-d14 (reagent grade)(99% chemical purity)
CAS:Formula:CD3(CD2)4CD3Purity:99 atom % DColor and Shape:Colorless LiquidMolecular weight:100.19742n-Hexane-D14 >99.0 Atom % D 5ml ampoule
CAS:<p>n-Hexane-D14 >99.0 Atom % D 5ml ampoule</p>Formula:C6D14Purity:>99.0 Atom % DColor and Shape:Colourless LiquidMolecular weight:100.26g/moln-Hexane-D14 >99.0 Atom % D 1ml ampoule
CAS:<p>n-Hexane-D14 >99.0 Atom % D 1ml ampoule</p>Purity:>99.0 Atom % DColor and Shape:Colourless LiquidMolecular weight:100.26g/molN-Hexane-d14
CAS:Controlled Product<p>Stability Volatile<br>Applications N-Hexane (D14, 98%) (cas# 21666-38-6) is a useful research chemical.<br></p>Formula:C6D14Color and Shape:ColourlessMolecular weight:100.26





