CAS 216672-17-2
:3-carboxy-2-oxo-2H-chromen-7-yl beta-D-glucopyranosiduronic acid
Description:
3-Carboxy-2-oxo-2H-chromen-7-yl beta-D-glucopyranosiduronic acid, with the CAS number 216672-17-2, is a complex organic compound characterized by its chromenone structure, which features a coumarin backbone. This substance contains a carboxylic acid group and a ketone functional group, contributing to its reactivity and potential biological activity. The presence of the beta-D-glucopyranosiduronic acid moiety indicates that it is a glycoside, which may enhance its solubility in water and influence its interaction with biological systems. The compound is likely to exhibit properties such as antioxidant activity, given the presence of the chromenone structure, which is known for its ability to scavenge free radicals. Additionally, the glucuronic acid component may play a role in metabolic processes, including detoxification and excretion. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting various diseases.
Formula:C16H14O11
InChI:InChI=1/C16H14O11/c17-9-10(18)12(14(22)23)27-16(11(9)19)25-6-2-1-5-3-7(13(20)21)15(24)26-8(5)4-6/h1-4,9-12,16-19H,(H,20,21)(H,22,23)/t9-,10-,11+,12-,16+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Carboxyumbelliferyl b-D-glucuronide
CAS:<p>3-Carboxyumbelliferyl b-D-glucuronide serves as a highly sensitive fluorogenic substrate for detecting b-glucuronidase activity. Upon enzymatic cleavage, it generates a fluorescent product enabling easy and accurate monitoring of enzyme activity in various applications, such as diagnostics, drug discovery, and research.</p>Purity:Min. 95%Color and Shape:White to off-white solid.Molecular weight:382.28 g/mol3-Carboxyumbelliferyl-β-D-glucuronide Dipotassium Salt
CAS:Controlled ProductFormula:C16H12O11•2KColor and Shape:NeatMolecular weight:419.36


