
CAS 216691-95-1
:7-Chloro-5-(4-hydroxyphenyl)-1-methyl-3-(2-naphthylmethyl)-2,3-dihydro-1H-1,4-benzodiazepin-2-one
Description:
7-Chloro-5-(4-hydroxyphenyl)-1-methyl-3-(2-naphthylmethyl)-2,3-dihydro-1H-1,4-benzodiazepin-2-one, with CAS number 216691-95-1, is a synthetic compound belonging to the benzodiazepine class. This compound features a complex structure characterized by a benzodiazepine core, which includes a chloro substituent and a hydroxyphenyl group, contributing to its potential biological activity. The presence of the naphthylmethyl group enhances its lipophilicity, which may influence its pharmacokinetic properties. Typically, benzodiazepines exhibit anxiolytic, sedative, and muscle relaxant effects, although the specific biological activity of this compound would require empirical investigation. Its molecular structure suggests potential interactions with the central nervous system, possibly affecting neurotransmitter systems. The compound's solubility, stability, and reactivity would depend on its specific functional groups and overall molecular conformation. As with many synthetic pharmaceuticals, safety and efficacy assessments are crucial for any therapeutic applications.
Formula:C27H21ClN2O2
InChI:InChI=1/C27H21ClN2O2/c1-30-25-13-10-21(28)16-23(25)26(19-8-11-22(31)12-9-19)29-24(27(30)32)15-17-6-7-18-4-2-3-5-20(18)14-17/h2-14,16,24,29H,15H2,1H3
SMILES:CN1c2ccc(cc2C(=C2C=CC(=O)C=C2)NC(Cc2ccc3ccccc3c2)C1=O)Cl
Synonyms:- Bz-423
- 7-chloro-1-methyl-3-(naphthalen-2-ylmethyl)-5-(4-oxocyclohexa-2,5-dien-1-ylidene)-1,3,4,5-tetrahydro-2H-1,4-benzodiazepin-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Bz 423
CAS:Bz 423 is a potent immunomodulator that induces apoptosis by activating Bax and Bak to induce mitochondrial outer membrane permeabilization and cytochrome cFormula:C27H21ClN2O2Purity:98.93%Color and Shape:SolidMolecular weight:440.92Bz 423
CAS:Controlled ProductBz 423 is a cyclic peptide that has been shown to have antimicrobial activity. It binds to the mitochondrial membrane potential and inhibits the production of stem cell factor, which is important in the pathogenesis of skin cells. Bz 423 also has a pharmacological treatment for inflammatory bowel disease and bowel disease, as well as an effect on autoimmune diseases. Bz 423 has been shown to inhibit epidermal growth factor and modulate inflammatory cytokines such as interleukin-6 and tumor necrosis factor alpha (TNF-α).Formula:C27H21ClN2O2Purity:Min. 95%Molecular weight:440.92 g/mol

