CAS 21671-00-1
:Shoreic acid
Description:
Shoreic acid, with the CAS number 21671-00-1, is a naturally occurring organic compound classified as a fatty acid. It is primarily derived from certain marine organisms, particularly from the genus of algae. Shoreic acid is characterized by its long hydrocarbon chain, which contributes to its hydrophobic properties, making it less soluble in water but more soluble in organic solvents. This compound typically exhibits a range of biological activities, including potential antimicrobial and antifungal properties, which have garnered interest in various fields, including pharmaceuticals and biochemistry. Additionally, shoreic acid may play a role in cellular signaling and membrane structure due to its fatty acid nature. Its structural features, including the presence of functional groups, influence its reactivity and interactions with other molecules. As research continues, the full scope of its applications and benefits in both natural and synthetic contexts is being explored, highlighting its significance in both ecological and industrial domains.
Formula:C30H50O4
InChI:InChI=1S/C30H50O4/c1-19(2)20-11-17-29(7)23(27(20,5)15-14-25(31)32)10-9-21-22(12-16-28(21,29)6)30(8)18-13-24(34-30)26(3,4)33/h20-24,33H,1,9-18H2,2-8H3,(H,31,32)/t20-,21+,22-,23+,24+,27-,28+,29+,30-/m0/s1
InChI key:InChIKey=ZKBGKWZSOPPDSD-INPVNEGFSA-N
SMILES:C[C@]12[C@@]3(C)[C@@]([C@](CCC(O)=O)(C)[C@H](C(C)=C)CC3)(CC[C@@]1([C@](CC2)([C@@]4(C)O[C@@H](C(C)(C)O)CC4)[H])[H])[H]
Synonyms:- 3,4-Secodammar-4(28)-en-3-oic acid, 20,24-epoxy-25-hydroxy-, (24R)-
- Shoric acid
- Shoreic acid
- (3S,3aR,5aR,6S,7S,9aR,9bR)-Dodecahydro-6,9a,9b-trimethyl-7-(1-methylethenyl)-3-[(2S,5R)-tetrahydro-5-(1-hydroxy-1-methylethyl)-2-methyl-2-furanyl]-1H-benz[e]indene-6-propanoic acid
- 1H-Benz[e]indene-6-propanoic acid, dodecahydro-6,9a,9b-trimethyl-7-(1-methylethenyl)-3-[(2S,5R)-tetrahydro-5-(1-hydroxy-1-methylethyl)-2-methyl-2-furanyl]-, (3S,3aR,5aR,6S,7S,9aR,9bR)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(24R)-20,24-Epoxy-25-hydroxy-3,4-seco-5α-dammar-4(28)-en-3-oic acid
CAS:Formula:C30H50O4Color and Shape:SolidMolecular weight:474.7156Shoreic acid
CAS:Shoreic acid fights E. coli, P. aeruginosa, S. aureus, B. subtilis, C. albicans, T. mentagrophytes, tuberculosis, and herpes simplex.Formula:C30H50O4Purity:98%Color and Shape:SolidMolecular weight:474.72Shoreic acid
CAS:Shoreic acid is a triterpenoid compound, which is a natural product derived from the resin of Shorea species trees. These trees, typically found in tropical regions, serve as the primary source of this compound. Shoreic acid exhibits a mode of action focused on interacting with cellular pathways to potentially modulate biochemical processes, which can lead to various health-related effects.Formula:C30H50O4Purity:Min. 95%Molecular weight:474.7 g/mol



