CAS 216757-29-8

N-acetyl-L-isoleucyl-L-alpha-glutamyl-L-prolyl-N-(4-nitrophenyl)-L-alpha-asparagine

Description:

N-acetyl-L-isoleucyl-L-alpha-glutamyl-L-prolyl-N-(4-nitrophenyl)-L-alpha-asparagine is a synthetic peptide that features a complex structure composed of multiple amino acids, including isoleucine, glutamic acid, proline, and asparagine, along with an acetyl group and a nitrophenyl moiety. This compound is characterized by its potential biological activity, which may include roles in peptide synthesis, drug development, or as a biochemical probe in research. The presence of the nitrophenyl group suggests potential applications in photochemistry or as a chromophore in various assays. The peptide's structure may influence its solubility, stability, and interaction with biological targets, making it of interest in medicinal chemistry and biochemistry. Additionally, the specific stereochemistry of the amino acids contributes to its overall conformation and functionality. As with many peptides, its properties can be affected by environmental factors such as pH and temperature, which are crucial for its stability and activity in biological systems.

Formula: C₂₈H₃₈N₆O₁₁

InChI: InChI=1/C28H38N6O11/c1-4-15(2)24(29-16(3)35)27(42)31-19(11-12-22(36)37)28(43)33-13-5-6-21(33)26(41)32-20(14-23(38)39)25(40)30-17-7-9-18(10-8-17)34(44)45/h7-10,15,19-21,24H,4-6,11-14H2,1-3H3,(H,29,35)(H,30,40)(H,31,42)(H,32,41)(H,36,37)(H,38,39)/t15-,19-,20-,21-,24-/m0/s1

SMILES: CC[C@H](C)[C@@H](C(=N[C@@H](CCC(=O)O)C(=O)N1CCC[C@H]1C(=N[C@@H](CC(=O)O)C(=O)Nc1ccc(cc1)N(=O)=O)O)O)N=C(C)O

Synonyms:

• Ac-Iepd-Pna

(S)-4-((2S,3S)-2-Acetamido-3-methylpentanamido)-5-((S)-2-(((S)-3-carboxy-1-((4-nitrophenyl)amino)-1-oxopropan-2-yl)carbamoyl)pyrrolidin-1-yl)-5-oxopentanoic acid

CAS: 216757-29-8

Formula: C₂₈H₃₈N₆O₁₁

Purity: 97%

Color and Shape: Solid

Molecular weight: 634.6349

Ref: IN-DA00BCJA

N-Acetyl-Ile-Glu-Pro-Asp-p-nitroanilide

CAS: 216757-29-8

N-Acetyl-Ile-Glu-Pro-Asp-p-nitroanilide

Purity: 98%

Ref: 54-OR1037219

Ac-Ile-Glu-Pro-Asp-pNA

CAS: 216757-29-8

Ac-Ile-Glu-Pro-Asp-pNA is a synthetic peptide that has been shown to induce apoptosis in tumor cells. The peptide was found to cause cell lysis and necrotic cell death, which is associated with the activation of serine proteases. Ac-Ile-Glu-Pro-Asp-pNA also has been shown to have a toxicity profile similar to other apoptotic agents such as staurosporine, but it has not been tested for its ability to kill cancer cells without causing damage to healthy cells. Ac-Ile-Glu-Pro-Asp-pNA induces mitochondrial membrane depolarization and protein synthesis inhibition in K562 cells, which are human erythroleukemia cells. This peptide also has shown an ability to bind with monoclonal antibodies and inhibit the growth of casein.

Formula: C₂₈H₃₈N₆O₁₁

Purity: Min. 95%

Molecular weight: 634.64 g/mol

Ref: 3D-FA110813