CymitQuimica logo

CAS 2168-16-3

:

2-(1-Piperidinylmethyl)-3-pyridinol

Description:
2-(1-Piperidinylmethyl)-3-pyridinol, with the CAS number 2168-16-3, is a chemical compound characterized by its unique structure that includes a piperidine ring and a pyridinolic moiety. This compound typically exhibits properties associated with both heterocyclic amines and alcohols, which can influence its solubility and reactivity. It is often studied for its potential biological activities, including its role in medicinal chemistry, where it may exhibit pharmacological effects such as acting as an intermediate in the synthesis of various pharmaceuticals. The presence of the piperidine group can enhance its ability to interact with biological targets, while the pyridinolic structure may contribute to its stability and reactivity. Additionally, this compound may be characterized by its melting point, boiling point, and spectral properties, which can be determined through various analytical techniques such as NMR, IR, and mass spectrometry. Overall, 2-(1-Piperidinylmethyl)-3-pyridinol is of interest in both synthetic and medicinal chemistry due to its structural features and potential applications.
Formula:C11H16N2O
InChI:InChI=1S/C11H16N2O/c14-11-5-4-6-12-10(11)9-13-7-2-1-3-8-13/h4-6,14H,1-3,7-9H2
InChI key:InChIKey=BMRGAJCUJCTATP-UHFFFAOYSA-N
SMILES:C(C1=C(O)C=CC=N1)N2CCCCC2
Synonyms:
  • 2-(1-Piperidinylmethyl)-3-Pyridinol
  • 3-Pyridinol, 2- (1-piperidinylmethyl)-
  • 3-Pyridinol, 2- (piperidinomethyl)-
  • NSC 75877
  • 2-(Piperidin-1-ylmethyl)pyridin-3-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.