CymitQuimica logo

CAS 216884-02-5

:

methyl 2-(3,4-dimethoxyphenyl)-3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanoate

Description:
Methyl 2-(3,4-dimethoxyphenyl)-3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanoate, with the CAS number 216884-02-5, is a synthetic organic compound characterized by its complex molecular structure, which includes a propanoate ester functional group and a substituted isoindole moiety. This compound features a methoxy-substituted phenyl group, contributing to its potential biological activity and solubility properties. The presence of the isoindole structure suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate lipophilicity due to the aromatic and aliphatic components, which may influence its pharmacokinetic properties. Additionally, the methoxy groups can enhance the compound's stability and reactivity. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature typically exhibit moderate to high stability under standard conditions. Further studies would be necessary to elucidate its full chemical behavior and potential applications in pharmaceuticals or other fields.
Formula:C20H21NO5
InChI:InChI=1/C20H21NO5/c1-24-17-9-8-13(10-18(17)25-2)16(20(23)26-3)12-21-11-14-6-4-5-7-15(14)19(21)22/h4-10,16H,11-12H2,1-3H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • CC-3052

    CAS:
    <p>CC-3052: water-soluble thalidomide analogue, inhibits HIV-1 and TNF-α in PBMC and monocyte adhesion.</p>
    Formula:C20H21NO5
    Color and Shape:Solid
    Molecular weight:355.38