CAS 2169-98-4: 1-(3,4-dimethoxyphenyl)-N-hydroxymethanimine

Description:1-(3,4-Dimethoxyphenyl)-N-hydroxymethanimine, with the CAS number 2169-98-4, is an organic compound characterized by its unique structure, which includes a hydroxymethanimine functional group attached to a dimethoxy-substituted phenyl ring. This compound typically exhibits properties associated with both aromatic and amine functionalities, such as potential reactivity in nucleophilic addition reactions due to the presence of the hydroxymethanimine moiety. The dimethoxy groups contribute to the compound's electron-donating characteristics, which can influence its reactivity and stability. In terms of solubility, compounds of this nature are often soluble in organic solvents, while their solubility in water may vary depending on the specific functional groups present. The presence of the hydroxyl group can also impart some degree of polarity. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. However, specific applications and biological effects would require further investigation and research.

Formula:C₉H₁₁NO₃

InChI:InChI=1S/C9H11NO3/c1-12-8-4-3-7(6-10-11)5-9(8)13-2/h3-6,11H,1-2H3

InChI key:InChIKey=LHZIVRAMZJJLAP-UHFFFAOYSA-N

SMILES:ON=CC1=CC=C(OC)C(OC)=C1

Synonyms:
Veratraldehyde, oxime
3,4-Dimethoxybenzaldoxime
Veratraldoxime
3,4-Dimethoxybenzaldehyde oxime
Benzaldehyde, 3,4-dimethoxy-, oxime
See more synonyms

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	3,4-Dimethoxybenzaldehyde oxime REF: 10-F047113CAS: 2169-98-4	98.0%	819.00 €~1,950.00 €	Wed 09 Apr 25
	Veratraldoxime REF: 3D-FV67644CAS: 2169-98-4	Min. 95%	147.00 €~669.00 €	Tue 20 May 25