CAS 216955-75-8

6-(1H-imidazol-1-yl)pyridine-3-carboxylic acid

Description:

6-(1H-imidazol-1-yl)pyridine-3-carboxylic acid, with the CAS number 216955-75-8, is a heterocyclic organic compound characterized by the presence of both a pyridine and an imidazole ring. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential for forming hydrogen bonds. The imidazole moiety provides unique electronic characteristics, making it a candidate for various biological activities, including potential roles in medicinal chemistry. The compound is typically soluble in polar solvents due to the presence of the carboxylic acid group, which can ionize in solution. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways or as a ligand in coordination chemistry. Additionally, the compound may exhibit interesting interactions with metal ions, enhancing its utility in catalysis or as a building block in supramolecular chemistry. Overall, 6-(1H-imidazol-1-yl)pyridine-3-carboxylic acid is a versatile compound with significant implications in both research and industrial applications.

Formula: C₉H₇N₃O₂

InChI: InChI=1/C9H7N3O2/c13-9(14)7-1-2-8(11-5-7)12-4-3-10-6-12/h1-6H,(H,13,14)

SMILES: c1cc(ncc1C(=O)O)n1ccnc1

Synonyms:

• 6-(1H-imidazol-1-yl)nicotinic acid

6-(1H-Imidazol-1-yl)nicotinic acid

CAS: 216955-75-8

Formula: C₉H₇N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 189.1708

Ref: IN-DA00BD7C

6-(1H-Imidazol-1-yl)nicotinic acid

CAS: 216955-75-8

6-(1H-Imidazol-1-yl)nicotinic acid

Formula: C₉H₇N₃O₂

Purity: 95

Color and Shape: Powder

Molecular weight: 189.17g/mol

Ref: 54-OR6116

6-(1H-Imidazol-1-yl)nicotinic acid

CAS: 216955-75-8

Formula: C₉H₇N₃O₂

Purity: 98%

Color and Shape: Off white powder

Molecular weight: 189.174

Ref: 10-F065883

6-(1H-Imidazol-1-yl)nicotinic acid

CAS: 216955-75-8

6-(1H-Imidazol-1-yl)nicotinic acid is a crystalline compound with an isotropic and monoclinic structure. It is a radioactive compound, which emits alpha particles when it decays. The radiation measurements are made using the parameters of the triclinic system. 6-(1H-Imidazol-1-yl)nicotinic acid has an atomic number of 71 and its crystal structure is asymmetric. This compound belongs to the class of organic compounds called nicotinamides, which are used in phototherapy for cancer treatment.

Formula: C₉H₇N₃O₂

Purity: Min. 95%

Molecular weight: 189.17 g/mol

Ref: 3D-RIA95575