CAS 216956-20-6
:5-[(3-Hydroxyphenyl)methyl]-2,4-imidazolidinedione
Description:
5-[(3-Hydroxyphenyl)methyl]-2,4-imidazolidinedione, also known by its CAS number 216956-20-6, is a chemical compound characterized by its imidazolidinedione core structure, which features a five-membered ring containing two nitrogen atoms and two carbonyl groups. This compound exhibits properties typical of imidazolidinediones, including potential biological activity due to the presence of the hydroxyl and phenyl groups, which may influence its solubility and reactivity. The hydroxyl group can participate in hydrogen bonding, enhancing its interactions with biological targets. Additionally, the phenyl ring contributes to the compound's lipophilicity, potentially affecting its pharmacokinetics. The compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development or as a biochemical probe. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the functional groups present. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C10H10N2O3
InChI:InChI=1S/C10H10N2O3/c13-7-3-1-2-6(4-7)5-8-9(14)12-10(15)11-8/h1-4,8,13H,5H2,(H2,11,12,14,15)
InChI key:InChIKey=SIDWPXBEWSODDF-UHFFFAOYSA-N
SMILES:C(C1C(=O)NC(=O)N1)C2=CC(O)=CC=C2
Synonyms:- 5-[(3-Hydroxyphenyl)methyl]-2,4-imidazolidinedione
- 2,4-Imidazolidinedione, 5-[(3-hydroxyphenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(3'-Hydroxybenzyl)hydantoin
CAS:Controlled ProductApplications 5-(3'-Hydroxybenzyl)hydantoin (cas# 216956-20-6) is a compound useful in organic synthesis.
Formula:C10H10N2O3Color and Shape:NeatMolecular weight:206.2
