CAS 216959-34-1

Ethyl [(tert-butoxycarbonyl)amino](oxo)acetate

Description:

Ethyl [(tert-butoxycarbonyl)amino](oxo)acetate is a chemical compound characterized by its functional groups and structural features. It contains an ethyl ester group, a tert-butoxycarbonyl (Boc) protecting group, and an oxo group, which indicates the presence of a carbonyl functionality. The Boc group is commonly used in organic synthesis to protect amines during chemical reactions, enhancing the stability and reactivity of the compound. The oxoacetate moiety suggests that this compound may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Its molecular structure allows for potential applications in peptide synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The compound is typically handled with standard laboratory safety precautions, as it may exhibit reactivity due to the presence of the carbonyl and amine functionalities. Overall, Ethyl [(tert-butoxycarbonyl)amino](oxo)acetate is a versatile intermediate in organic synthesis, valued for its protective group and functional diversity.

Formula: C₉H₁₅NO₅

InChI: InChI=1/C9H15NO5/c1-5-14-7(12)6(11)10-8(13)15-9(2,3)4/h5H2,1-4H3,(H,10,11,13)

SMILES: CCOC(=O)C(=NC(=O)OC(C)(C)C)O

Synonyms:

• Acetic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-2-oxo-, ethyl ester
• Ethyl N-Boc-Oxamate

Ethyl 2-((tert-butoxycarbonyl)amino)-2-oxoacetate

CAS: 216959-34-1

Formula: C₉H₁₅NO₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 217.2191

Ref: IN-DA0039MX

Ethyl [(tert-butoxycarbonyl)amino](oxo)acetate

CAS: 216959-34-1

Ethyl [(tert-butoxycarbonyl)amino](oxo)acetate

Formula: C₉H₁₅NO₅

Purity: 95%

Color and Shape: colourless liquid

Molecular weight: 217.22g/mol

Ref: 54-OR953671

Ethyl N-Boc-oxamidate

CAS: 216959-34-1

Molecular weight: 217.22

Ref: 7W-GM5744

Ethyl N-(tert-butoxycarbonyl)oxamate

CAS: 216959-34-1

Formula: C₉H₁₅NO₅

Purity: 97%

Color and Shape: Liquid, Viscous

Molecular weight: 217.221

Ref: 10-F011725

Ethyl N-Boc-oxamidate

CAS: 216959-34-1

Ethyl N-Boc-oxamidate is a nucleophile that is part of the molecule vigabatrin, which is used to treat epilepsy. It is synthesized by the reaction of an amine with a hydroxyl group. Ethyl N-Boc-oxamidate binds to enantiopure amines and hydrochloride salts in order to produce the drug vigabatrin. This synthetic process can be scaled up to produce large quantities of this product.

Formula: C₉H₁₅NO₅

Purity: Min. 95%

Molecular weight: 217.22 g/mol

Ref: 3D-RIA95934