CymitQuimica logo

CAS 216966-37-9

:

1,6-Naphthyridin-3-amine,5,6,7,8-tetrahydro-6-methyl-

Description:
1,6-Naphthyridin-3-amine, 5,6,7,8-tetrahydro-6-methyl- is a chemical compound characterized by its bicyclic structure, which includes a naphthyridine moiety. This compound features an amine functional group and is tetrahydro, indicating the presence of four hydrogen atoms that saturate the ring system, contributing to its stability and reactivity. The methyl group at the 6-position enhances its lipophilicity, potentially influencing its biological activity and solubility properties. The presence of the amine group suggests that it may participate in hydrogen bonding, making it a candidate for various chemical reactions, including nucleophilic substitutions. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and interactions would depend on further studies, including its synthesis, biological activity, and potential therapeutic uses. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C9H13N3
InChI:InChI=1S/C9H13N3/c1-12-3-2-9-7(6-12)4-8(10)5-11-9/h4-5H,2-3,6,10H2,1H3
InChI key:YWVJXRLEURDFAJ-UHFFFAOYSA-N
SMILES:CN1CCC2=C(C1)C=C(C=N2)N
Found 4 products.