CAS 216971-58-3: β-D-Glucopyranosiduronic acid, 1H-indol-3-yl, compd. with cyclohexanamine (1:1)
Description:β-D-Glucopyranosiduronic acid, 1H-indol-3-yl, compd. with cyclohexanamine (1:1) is a chemical compound characterized by its unique structural components, which include a glucuronic acid derivative and an indole moiety. The glucuronic acid part contributes to its hydrophilic properties, while the indole structure can impart biological activity, often associated with neurotransmitter functions. The presence of cyclohexanamine suggests potential interactions that may enhance solubility or stability in biological systems. This compound may exhibit interesting pharmacological properties due to the combination of these functional groups, potentially influencing its reactivity and interaction with biological targets. Its CAS number, 216971-58-3, allows for precise identification in chemical databases. Overall, the compound's characteristics suggest it could be of interest in medicinal chemistry, particularly in the development of therapeutic agents that leverage the properties of both the glucuronic acid and indole components. Further studies would be necessary to elucidate its specific biological activities and potential applications.
Formula:C14H15NO7·C6H13N
InChI:InChI=1S/C14H15NO7.C6H13N/c16-9-10(17)12(13(19)20)22-14(11(9)18)21-8-5-15-7-4-2-1-3-6(7)8;7-6-4-2-1-3-5-6/h1-5,9-12,14-18H,(H,19,20);6H,1-5,7H2/t9-,10-,11+,12-,14+;/m0./s1
InChI key:InChIKey=YGIPNZMTCTUCAX-CYRSAHDMSA-N
SMILES:O=C(O)C1OC(OC2=CNC=3C=CC=CC23)C(O)C(O)C1O.NC1CCCCC1
- Synonyms:
- beta-D-Glucopyranosiduronic acid, 1H-indol-3-yl, compd. with cyclohexanamine (1:1)
- β-<span class="text-smallcaps">D</span>-Glucopyranosiduronic acid, 1H-indol-3-yl, compd. with cyclohexanamine (1:1)
- β-D-Glucopyranosiduronic acid, 1H-indol-3-yl, compd. with cyclohexanamine (1:1)
- Cyclohexanamine - 1H-indol-3-yl beta-D-glucopyranosiduronic acid (1:1)
