CAS 216976-30-6
:3-Fluoro-5-methylbenzonitrile
Description:
3-Fluoro-5-methylbenzonitrile is an aromatic compound characterized by the presence of a fluorine atom and a methyl group attached to a benzene ring, along with a nitrile functional group. The molecular structure consists of a benzene ring substituted at the 3-position with a fluorine atom and at the 5-position with a methyl group, while the nitrile (-C≡N) group is typically attached to the benzene ring. This compound is known for its potential applications in pharmaceuticals and agrochemicals due to the reactivity of the nitrile group and the influence of the fluorine atom on the compound's electronic properties. It is generally a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it an interesting candidate for various chemical syntheses and biological studies. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H6FN
InChI:InChI:1S/C8H6FN/c1-6-2-7(5-10)4-8(9)3-6/h2-4H,1H3
Synonyms:- 3-Cyano-5-Fluorotoluene
- Q1R Cg Dxfff
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Fluoro-5-methylbenzonitrile
CAS:Formula:C8H6FNPurity:97%Color and Shape:SolidMolecular weight:135.13833-Fluoro-5-methylbenzonitrile
CAS:3-Fluoro-5-methylbenzonitrileFormula:C8H6FNPurity:95%Color and Shape: white solidMolecular weight:135.14g/mol3-Fluoro-5-methylbenzonitrile
CAS:3-Fluoro-5-methylbenzonitrile is a reactive halogen molecule that can be used in model compounds, such as 3-fluoro-5-methylbenzoic acid. It has been shown to react with nucleophiles in the presence of microwaves, yielding high yields. The compound can be labeled with a variety of labels, including fluorine isotopes, which can be useful for tracking the compound's metabolism.Formula:C8H6FNPurity:Min. 95%Color and Shape:PowderMolecular weight:135.14 g/mol3-Fluoro-5-methylbenzonitrile
CAS:Formula:C8H6FNPurity:97%Color and Shape:SolidMolecular weight:135.141



