CAS 2169997-50-4

3-Azabicyclo[3.1.0]hexane, 1-ethyl-, hydrochloride (1:1)

Description:

3-Azabicyclo[3.1.0]hexane, 1-ethyl-, hydrochloride (1:1) is a bicyclic organic compound characterized by its unique bicyclic structure, which includes a nitrogen atom integrated into the ring system. This compound features a bicyclo[3.1.0] framework, indicating that it consists of three carbon atoms and one nitrogen atom in a six-membered ring, with an ethyl group attached to one of the nitrogen's hydrogen atoms. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in water. The presence of the hydrochloride group suggests that it can dissociate in solution, releasing protons and forming a positively charged ammonium ion. This compound may exhibit biological activity, potentially influencing neurotransmitter systems or serving as a precursor in synthetic organic chemistry. Its specific properties, such as melting point, solubility, and reactivity, would depend on the conditions under which it is studied. As with many nitrogen-containing heterocycles, it may also display interesting pharmacological properties, warranting further investigation in medicinal chemistry.

Formula: C₇H₁₃N.ClH

InChI: InChI=1S/C7H13N.ClH/c1-2-7-3-6(7)4-8-5-7;/h6,8H,2-5H2,1H3;1H

InChI key: InChIKey=NYKKQKLJGDWWIM-UHFFFAOYSA-N

SMILES: C(C)C12C(C1)CNC2.Cl

1-ethyl-3-azabicyclo[3.1.0]hexane hydrochloride

CAS: 2169997-50-4

Formula: C₇H₁₄ClN

Purity: 95.0%

Molecular weight: 147.65

Ref: 10-F541524