CAS 2169997-52-6

1,4-Dioxino[2,3-c]pyridine-7-carboxylic acid, 2,3-dihydro-, hydrochloride (1:1)

Description:

1,4-Dioxino[2,3-c]pyridine-7-carboxylic acid, 2,3-dihydro-, hydrochloride (1:1), identified by the CAS number 2169997-52-6, is a chemical compound that features a fused dioxin and pyridine structure. This compound typically exhibits properties associated with both heterocyclic compounds and carboxylic acids, including potential acidity due to the carboxylic acid functional group. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, which can enhance its solubility in water and influence its stability and reactivity. The presence of the dioxin moiety may impart unique electronic and steric properties, making it of interest in various chemical and pharmaceutical applications. Its structural characteristics suggest potential biological activity, which may be explored in medicinal chemistry. However, specific details regarding its reactivity, stability, and biological effects would require further investigation through experimental studies and literature review.

Formula: C₈H₇NO₄·ClH

InChI: InChI=1S/C8H7NO4.ClH/c10-8(11)5-3-6-7(4-9-5)13-2-1-12-6;/h3-4H,1-2H2,(H,10,11);1H

InChI key: InChIKey=XLHWFTWGEVCMOM-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C2C(=CN1)OCCO2.Cl

Synonyms:

• 1,4-Dioxino[2,3-c]pyridine-7-carboxylic acid, 2,3-dihydro-, hydrochloride (1:1)

2,3-dihydro[1,4]dioxino[2,3-c]pyridine-7-carboxylic acid hydrochloride

CAS: 2169997-52-6

Formula: C₈H₈ClNO₄

Purity: 95.0%

Molecular weight: 217.61

Ref: 10-F541539