CAS 2169997-54-8

1H-Pyrazole-1-acetic acid, 4-amino-, ethyl ester, hydrochloride (1:2)

Description:

1H-Pyrazole-1-acetic acid, 4-amino-, ethyl ester, hydrochloride (1:2) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an acetic acid moiety and an ethyl ester group, contributing to its solubility and reactivity. The presence of the amino group at the 4-position of the pyrazole ring enhances its potential for biological activity, making it of interest in pharmaceutical research. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, facilitating its use in various applications. The compound's molecular structure suggests it may exhibit properties such as acidity due to the carboxylic acid group and basicity from the amino group, allowing for interactions in biological systems. Its CAS number, 2169997-54-8, provides a unique identifier for regulatory and research purposes. Overall, this compound's unique structural features and functional groups make it a subject of interest in medicinal chemistry and drug development.

Formula: C₇H₁₁N₃O₂·2ClH

InChI: InChI=1S/C7H11N3O2.2ClH/c1-2-12-7(11)5-10-4-6(8)3-9-10;;/h3-4H,2,5,8H2,1H3;2*1H

InChI key: InChIKey=IONZTCAFMJOAOX-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)N1C=C(N)C=N1.Cl

Synonyms:

• 1H-Pyrazole-1-acetic acid, 4-amino-, ethyl ester, hydrochloride (1:2)

ethyl (4-amino-1H-pyrazol-1-yl)acetate dihydrochloride

CAS: 2169997-54-8

Formula: C₇H₁₃Cl₂N₃O₂

Purity: 95.0%

Molecular weight: 242.1

Ref: 10-F541600