CAS 2169997-56-0

Pyrido[4,3-d]pyrimidine-2-methanamine, 5,6,7,8-tetrahydro-6-methyl-, hydrochloride (1:3)

Description:

Pyrido[4,3-d]pyrimidine-2-methanamine, 5,6,7,8-tetrahydro-6-methyl-, hydrochloride (1:3) is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound typically exhibits properties associated with amines, such as basicity and the ability to form salts, as indicated by its hydrochloride form. The presence of the tetrahydro moiety suggests that it is a saturated derivative, which may influence its reactivity and solubility in various solvents. The methyl group at the 6-position of the tetrahydro structure can affect its steric and electronic properties, potentially impacting its biological activity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals or biochemistry. The specific interactions and potential applications of this compound would depend on its biological activity, which may be explored in medicinal chemistry contexts.

Formula: C₉H₁₄N₄·3ClH

InChI: InChI=1S/C9H14N4.3ClH/c1-13-3-2-8-7(6-13)5-11-9(4-10)12-8;;;/h5H,2-4,6,10H2,1H3;3*1H

InChI key: InChIKey=ORWYTPHACQDNFH-UHFFFAOYSA-N

SMILES: C(N)C=1N=C2C(CN(C)CC2)=CN1.Cl

Synonyms:

• Pyrido[4,3-d]pyrimidine-2-methanamine, 5,6,7,8-tetrahydro-6-methyl-, hydrochloride (1:3)

[(6-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)methyl]amine trihydrochloride

CAS: 2169997-56-0

Formula: C₉H₁₇Cl₃N₄

Purity: 95.0%

Molecular weight: 287.61

Ref: 10-F541549