CAS 2169997-57-1

4-Piperidinamine, 1-(3-methyl-1,2,4-triazolo[4,3-a]pyrazin-8-yl)-, hydrochloride (1:3)

Description:

4-Piperidinamine, 1-(3-methyl-1,2,4-triazolo[4,3-a]pyrazin-8-yl)-, hydrochloride (1:3) is a chemical compound characterized by its complex structure, which includes a piperidine ring and a triazolo-pyrazine moiety. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications, particularly in pharmaceutical research. The presence of the piperidine group suggests potential biological activity, as piperidine derivatives are often found in numerous bioactive compounds. The triazolo-pyrazine component may contribute to its pharmacological properties, possibly influencing interactions with biological targets. The compound's molecular weight, solubility, and stability can vary based on environmental conditions and the specific formulation. As with many synthetic organic compounds, safety data, including toxicity and handling precautions, should be reviewed before use. Overall, this compound represents a class of substances that may have significant implications in medicinal chemistry and drug development.

Formula: C₁₁H₁₆N₆·3ClH

InChI: InChI=1S/C11H16N6.3ClH/c1-8-14-15-11-10(13-4-7-17(8)11)16-5-2-9(12)3-6-16;;;/h4,7,9H,2-3,5-6,12H2,1H3;3*1H

InChI key: InChIKey=HLXZRNNWKUXCTF-UHFFFAOYSA-N

SMILES: CC=1N2C(C(=NC=C2)N3CCC(N)CC3)=NN1.Cl

Synonyms:

• 4-Piperidinamine, 1-(3-methyl-1,2,4-triazolo[4,3-a]pyrazin-8-yl)-, hydrochloride (1:3)

1-{3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-yl}piperidin-4-amine trihydrochloride

CAS: 2169997-57-1

Formula: C₁₁H₁₉Cl₃N₆

Purity: 95.0%

Molecular weight: 341.67

Ref: 10-F541867