CAS 2169998-45-0

5H-Pyrrolo[2,1-c]-1,2,4-triazole-6-methanamine, 6,7-dihydro-3-methyl-, hydrochloride (1:2)

Description:

5H-Pyrrolo[2,1-c]-1,2,4-triazole-6-methanamine, 6,7-dihydro-3-methyl-, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which incorporates a pyrrole and triazole moiety. This compound typically exhibits properties associated with nitrogen-rich heterocycles, such as potential biological activity and solubility in polar solvents due to the presence of the hydrochloride salt form. The presence of the methanamine group suggests it may engage in hydrogen bonding, influencing its reactivity and interactions with biological targets. Its molecular structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. The compound's hydrochloride form enhances its stability and solubility, which is advantageous for formulation in pharmaceutical applications. As with many heterocyclic compounds, it may exhibit a range of activities, including antimicrobial or anticancer properties, although specific biological data would be necessary to confirm these effects. Overall, this compound represents a class of substances that are valuable in drug discovery and development.

Formula: C₇H₁₂N₄·2ClH

InChI: InChI=1S/C7H12N4.2ClH/c1-5-9-10-7-2-6(3-8)4-11(5)7;;/h6H,2-4,8H2,1H3;2*1H

InChI key: InChIKey=UBUJZZOGYVDHPD-UHFFFAOYSA-N

SMILES: CC=1N2C(CC(CN)C2)=NN1.Cl

Synonyms:

• 5H-Pyrrolo[2,1-c]-1,2,4-triazole-6-methanamine, 6,7-dihydro-3-methyl-, hydrochloride (1:2)

[(3-methyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-6-yl)methyl]amine dihydrochloride

CAS: 2169998-45-0

Formula: C₇H₁₄Cl₂N₄

Purity: 95.0%

Molecular weight: 225.12

Ref: 10-F541552