CAS 217-68-5

dibenzo[f,h]quinoxaline

Description:

Dibenzo[f,h]quinoxaline is a polycyclic aromatic compound characterized by its fused benzene and quinoxaline rings. It has a molecular formula that reflects its complex structure, consisting of carbon and nitrogen atoms. This compound is typically a solid at room temperature and exhibits a high melting point, indicative of strong intermolecular interactions. Dibenzo[f,h]quinoxaline is known for its fluorescent properties, making it of interest in various applications, including organic electronics and photonic devices. Its chemical stability and ability to participate in various chemical reactions, such as electrophilic substitutions, further enhance its utility in synthetic organic chemistry. Additionally, dibenzo[f,h]quinoxaline has been studied for its potential biological activities, including antitumor properties, which adds to its significance in medicinal chemistry. Overall, this compound's unique structural features and versatile chemical behavior make it a valuable subject of study in both academic and industrial contexts.

Formula: C₁₆H₁₀N₂

InChI: InChI=1/C16H10N2/c1-3-7-13-11(5-1)12-6-2-4-8-14(12)16-15(13)17-9-10-18-16/h1-10H

SMILES: c1ccc2c(c1)c1ccccc1c1c2nccn1

Synonyms:

• 1,4-Diazatriphenylene

Dibenzo[f,h]quinoxaline

CAS: 217-68-5

Formula: C₁₆H₁₀N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 230.2640

Ref: IN-DA007P6Q

Dibenzo[f,h]quinoxaline

CAS: 217-68-5

Dibenzo[f,h]quinoxaline

Purity: 98%

Molecular weight: 230.26g/mol

Ref: 54-OR89835

Dibenzo[f,h]quinoxaline

CAS: 217-68-5

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 230.27000427246094

Ref: 10-F329699